uitsluitend voor onderzoeksdoeleinden
Cat.Nr.S8146
| Gerelateerde doelwitten | HDAC PARP ATM/ATR DNA-PK WRN DNA/RNA Synthesis Topoisomerase PPAR Sirtuin Casein Kinase |
|---|---|
| Overige Antineoplastic and Immunosuppressive Antibiotics Inhibitoren | Staurosporine (STS) Cyclosporin A Oligomycin A (MCH 32) Puromycin Dihydrochloride Nigericin sodium salt Geldanamycin (NSC 122750) Honokiol Streptozotocin (STZ) Sodium Monensin (NSC 343257) Cephalomannine |
| Cellijnen | Assaytype | Concentratie | Incubatietijd | Formulering | Activiteitsbeschrijving | PMID |
|---|---|---|---|---|---|---|
| human CH1 (ovarian) tumor cell | Cytotoxic assay | The compound was evaluated for the cytotoxicity against human CH1 (ovarian) tumor cell lines, IC50=40 nM | 10698444 | |||
| human HT-29 (colon) tumor cell | Cytotoxic assay | The compound was evaluated for the cytotoxicity against human HT-29 (colon) tumor cell lines, IC50=40 nM | 10698444 | |||
| human A2780 (ovarian) tumor cell | Cytotoxic assay | The compound was evaluated for the cytotoxicity against human A2780 (ovarian) tumor cell lines, IC50=50 nM | 10698444 | |||
| human colon cancer cell line HCT15 | Cytotoxic assay | 72 h | In vitro cytotoxic activity against human colon cancer cell line HCT15 after 72 hr of drug exposure determined by the SRB assay, IC50=70 nM | 14980672 | ||
| Human Caki-1 Renal CellCarcinoma Cell | Function assay | 96 h | Inhibitory concentration against Human Caki-1 Renal CellCarcinoma Cell Lines (CD70+) at 96th hour, ic50=40 nM | 15743178 | ||
| SW480 colon cancer cell | Growth inhibition assay | In vitro inhibition of SW480 colon cancer cell line, IC50=7 nM | 1920349 | |||
| WiDr colon cancer cell | Growth inhibition assay | In vitro inhibition of WiDr colon cancer cell line, IC50=10 nM | 1920349 | |||
| HeLa | Function assay | In vitro anticellular activity against HeLa cells., IC50 = 0.81 μM. | 1495011 | |||
| L1210 | Function assay | Inhibitory concentration on parentral (sensitive) L1210 leukemia cells., IC50 = 0.09 μM. | 1906107 | |||
| L1210 | Function assay | Inhibitory concentration on multidrug-resistant L1210 leukemia cells., IC50 = 1.5 μM. | 1906107 | |||
| P388 | Antitumor assay | Antitumor potency on P388 leukemia cells in culture, IC50 = 0.0508 μM. | 1906109 | |||
| HT-29 | Antiproliferative assay | 96 hrs | Antiproliferative activity against human HT-29 cells after 96 hrs by MTT assay, IC50 = 0.099 μM. | 2778449 | ||
| P388 | Antiproliferative assay | 48 hrs | Antiproliferative activity against mouse P388 cells after 48 hrs by MTT assay, IC50 = 3 μM. | 2778449 | ||
| AA8 | Function assay | 4 hrs | Inhibitory activity of compound for AA8 cells to reduce cell density by 50% (exposed to compound for 4 hours), IC50 = 0.00108 μM. | 2909741 | ||
| L1210 | Growth inhibition assay | 8-9 hrs | Inhibition of L1210 leukemia cells, after exposure to compound for period of 8-9 hr, ID50 = 0.18 μM. | 3397995 | ||
| L1210 | Growth inhibition assay | 1 hr | Inhibition of L1210 leukemia cells, after exposure to compound for period of 1 hr, ID50 = 3.1 μM. | 3397995 | ||
| EMT6 | Function assay | 1 hr | Compound is measured for surviving fractions of EMT6 tumor cells treated in culture with (0.50 uM) concentration for 1 hr under hypoxic condition., ED50 = 0.001 μM. | 7452674 | ||
| EMT6 | Function assay | 1 hr | Compound is measured for surviving fractions of EMT6 tumor cells treated in culture with (0.50 uM) concentration for 1 hr under aerobic condition., ED50 = 0.7 μM. | 7452674 | ||
| V79 | Function assay | Inhibitory concentration required to kill 50% of the cells was evaluated under anaerobic (N2) conditions from chinese hamster V79 cells., IC50 = 0.4 μM. | 7966141 | |||
| V79 | Function assay | Inhibitory concentration required to kill 50% of the cells was evaluated under aerobic conditions from chinese hamster V79 cells., IC50 = 0.8 μM. | 7966141 | |||
| HeLa S3 | Function assay | In vitro anticellular activity against HeLa S3 cells; 0.59-1.1, IC50 = 1.1 μM. | 8021918 | |||
| HeLa S3 | Function assay | In vitro anticellular activity against HeLa S3 cells; 0.82-1.4, IC50 = 1.4 μM. | 8021918 | |||
| HeLa S3 | Function assay | In vitro anticellular activity against HeLa S3 cells, IC50 = 0.59 μM. | 8021919 | |||
| P388 | Function assay | Evaluation of inhibitory activity against drug sensitive P388 cells (P388/S) cells, IC50 = 0.048 μM. | 8544183 | |||
| P388 | Function assay | Evaluation of inhibitory activity against multidrug resistant P388 cells (P388/ADR) cells, IC50 = 0.535 μM. | 8544183 | |||
| HL-60 | Growth inhibition assay | Inhibition of cell growth was studied in human promyelocytic leukemic (HL-60) cells., IC50 = 0.05 μM. | 8709111 | |||
| DC-3F | Growth inhibition assay | Inhibition of cell growth was studied in chinese hamster lung cells (DC-3F), IC50 = 0.082 μM. | 8709111 | |||
| DC-3F/AD-II | Growth inhibition assay | Inhibition of cell growth was studied in chinese hamster lung cells resistant to actinomycin D (DC-3F/AD-II)., IC50 = 0.11 μM. | 8709111 | |||
| V79-379A | Function assay | In vitro concentration required to kill hypoxic cells V79-379A cells, C50 = 0.4 μM. | 9240349 | |||
| aerobic cell | Function assay | In vitro concentration required to kill 50% of the aerobic cells, C50 = 0.8 μM. | 9240349 | |||
| SupT1 | Antiproliferative assay | Antiproliferative activity of compound was evaluated on SupT1 cells from human non-Hodgkin lymphoma, ID50 = 0.7 μM. | 11012027 | |||
| Molt3 | Antiproliferative assay | Antiproliferative activity of compound was evaluated on Molt3 cells from human lymphoblastic leukemia, ID50 = 2.66 μM. | 11012027 | |||
| MCF-7 | Antiproliferative assay | Antiproliferative activity of compound was evaluated on MCF-7 cells from human breast adenocarcinoma, ID50 = 42.92 μM. | 11012027 | |||
| lung cancer cell | Cytotoxicity assay | Cytotoxicity against human lung cancer cells, GI50 = 0.023 μM. | 11473418 | |||
| breast cancer cell | Cytotoxicity assay | Cytotoxicity against human breast cancer cells, GI50 = 0.034 μM. | 11473418 | |||
| CNS cancer cell | Cytotoxicity assay | Cytotoxicity against human CNS cancer cells, GI50 = 0.064 μM. | 11473418 | |||
| stomach cancer cell | Cytotoxicity assay | Cytotoxicity against human stomach cancer cells, GI50 = 0.1 μM. | 11473418 | |||
| ovarian cancer cell | Cytotoxicity assay | Cytotoxicity against human ovarian cancer cells, GI50 = 0.12 μM. | 11473418 | |||
| colon cancer cell | Cytotoxicity assay | Cytotoxicity against human colon cancer cells, GI50 = 0.18 μM. | 11473418 | |||
| HeLa | Cytotoxicity assay | 5 to 8 days | Cytotoxicity against human HeLa cells assessed as inhibition of colony formation after 5 to 8 days by colony assay, IC50 = 0.068 μM. | 11975488 | ||
| K562 | Function assay | In vitro inhibitory activity against K562 leukemia cells, IC50 = 0.001 μM. | 12699386 | |||
| K562 | Function assay | In vitro inhibitory activity against K562 leukemia cells in the presence of pd2, IC50 = 0.0158 μM. | 12699386 | |||
| SCL9 | Cytotoxicity assay | Cytotoxicity against human SCL9 cells by MTT assay, ED50 = 17.4 μM. | 12880314 | |||
| SCL37'6 | Cytotoxicity assay | Cytotoxicity against human SCL37'6 cells by MTT assay, ED50 = 19 μM. | 12880314 | |||
| NUGC4 | Cytotoxicity assay | Cytotoxicity against human NUGC4 cells by MTT assay, ED50 = 19.1 μM. | 12880314 | |||
| SCL | Cytotoxicity assay | Cytotoxicity against human SCL cells by MTT assay, ED50 = 20.2 μM. | 12880314 | |||
| SCL6 | Cytotoxicity assay | Cytotoxicity against human SCL6 cells by MTT assay, ED50 = 20.7 μM. | 12880314 | |||
| KATO III | Cytotoxicity assay | Cytotoxicity against human KATO III cells by MTT assay, ED50 = 49 μM. | 12880314 | |||
| A549 | Cytotoxicity assay | 3 days | Cytotoxicity against human A549 cells after 3 days by SRB assay, IC50 = 0.3 μM. | 16038545 | ||
| KB | Cytotoxicity assay | 3 days | Cytotoxicity against human KB cells after 3 days by SRB assay, IC50 = 0.6 μM. | 16038545 | ||
| HCT8 | Cytotoxicity assay | 3 days | Cytotoxicity against human HCT8 cells after 3 days by SRB assay, IC50 = 0.6 μM. | 16038545 | ||
| MCF7 | Cytotoxicity assay | 3 days | Cytotoxicity against human MCF7 cells after 3 days by SRB assay, IC50 = 1.5 μM. | 16038545 | ||
| PC3 | Cytotoxicity assay | Cytotoxicity against human PC3 cells assessed as cell viability by tryptan blue staining method, EC50 = 0.14 μM. | 17950604 | |||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells assessed as cell viability by tryptan blue staining method, EC50 = 0.43 μM. | 17950604 | |||
| Fb | Cytotoxicity assay | Cytotoxicity against human Fb cells assessed as cell viability by tryptan blue staining method, EC50 = 0.93 μM. | 17950604 | |||
| MCF7 | Cytotoxicity assay | Cytotoxicity against human MCF7 cells assessed as cell viability by tryptan blue staining method, EC50 = 0.96 μM. | 17950604 | |||
| Hc | Cytotoxicity assay | Cytotoxicity against human Hc cells assessed as cell viability by tryptan blue staining method, EC50 = 1.46 μM. | 17950604 | |||
| IE | Cytotoxicity assay | Cytotoxicity against human IE cells assessed as cell viability by tryptan blue staining method, EC50 = 1.46 μM. | 17950604 | |||
| MPC5 | Cytotoxicity assay | Cytotoxicity against human MPC5 cells assessed as cell viability by tryptan blue staining method, EC50 = 2.1 μM. | 17950604 | |||
| MCF7 | Cytotoxicity assay | Cytotoxicity against human MCF7 cells by Alamar blue assay, IC50 = 0.2 μM. | 18037301 | |||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs, IC50 = 0.24 μM. | 18037301 | ||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells by Alamar blue assay, IC50 = 0.4 μM. | 18037301 | |||
| MCF7 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human MCF7 cells after 72 hrs, IC50 = 1.2 μM. | 18037301 | ||
| A549 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human A549 cells after 24 hrs, IC50 = 4.5 μM. | 18037301 | ||
| MCF7 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human MCF7 cells after 24 hrs, IC50 = 5 μM. | 18037301 | ||
| HT29 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HT29 cells after 72 hrs by MTT assay, IC50 = 0.9 μM. | 18222567 | ||
| HT29 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HT29 cells after 72 hrs by MTT assay in presence of 2 uM dicoumarol, IC50 = 2.1 μM. | 18222567 | ||
| V-C8 | Cytotoxicity assay | 3 days | Cytotoxicity against BRCA2-deficient Chinese hamster V-C8 mutant cells after 3 days by WST1 cell viability assay, IC50 = 0.005 μM. | 18505284 | ||
| BAC29 | Cytotoxicity assay | 3 days | Cytotoxicity against BRCA2-proficient Chinese hamster BAC29 mutant cells after 3 days by WST1 cell viability assay, IC50 = 0.4 μM. | 18505284 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human MCF7 cells after 72 hrs by Alamar Blue assay, IC50 = 0.2 μM. | 18752870 | ||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs by Alamar Blue assay, IC50 = 0.4 μM. | 18752870 | ||
| HCT8 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HCT8 cells after 72 hrs by SRB assay, IC50 = 0.083 μM. | 18845441 | ||
| HCT8 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HCT8 cells after 72 hrs by SRB assay, IC90 = 5.7 μM. | 18845441 | ||
| WiDr | Cytotoxicity assay | Cytotoxicity against human WiDr cells by MTT assay, ED50 = 0.18 μM. | 19061391 | |||
| Daoy | Cytotoxicity assay | Cytotoxicity against human Daoy cells by MTT assay, ED50 = 0.21 μM. | 19061391 | |||
| HL60 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HL60 cells after 48 hrs by SRB assay, IC50 = 1.5 μM. | 19432411 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 3.3 μM. | 19432411 | ||
| SMMC7721 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SMMC7721 cells after 48 hrs by SRB assay, IC50 = 5.4 μM. | 19432411 | ||
| PC3 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human PC3 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.14 μM. | 19674905 | ||
| A549 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human A549 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.43 μM. | 19674905 | ||
| Hs888Lu | Antiproliferative assay | 72 hrs | Antiproliferative activity against human Hs888Lu cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.56 μM. | 19674905 | ||
| MCF7 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human MCF7 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.96 μM. | 19674905 | ||
| SVCT-M12 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human SVCT-M12 cells after 72 hrs by trypan blue exclusion assay, EC50 = 0.96 μM. | 19674905 | ||
| IE | Antiproliferative assay | 72 hrs | Antiproliferative activity against human IE cells after 72 hrs by trypan blue exclusion assay, EC50 = 1.46 μM. | 19674905 | ||
| MPC5 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human MPC5 cells after 72 hrs by trypan blue exclusion assay, EC50 = 2.1 μM. | 19674905 | ||
| PC3 | Growth inhibition assay | 48 hrs | Growth inhibition of human PC3 cells after 48 hrs by sulforhodamine B assay, IC50 = 1.5 μM. | 19939522 | ||
| Hep2 | Growth inhibition assay | 48 hrs | Growth inhibition of human Hep2 cells after 48 hrs by sulforhodamine B assay, IC50 = 1.5 μM. | 19939522 | ||
| Daudi | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of human Daudi cells after 24 to 72 hrs by MTT assay, IC50 = 0.45 μM. | 20117936 | ||
| K562 | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of human K562 cells after 24 to 72 hrs by MTT assay, IC50 = 0.47 μM. | 20117936 | ||
| K562-Lucena 1 | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of human K562-Lucena 1 cells after 24 to 72 hrs by MTT assay, IC50 = 2.75 μM. | 20117936 | ||
| PBMC | Growth inhibition assay | 24 to 72 hrs | Growth inhibition of phytohemagglutinin-activated human PBMC cells after 24 to 72 hrs by MTT assay, IC50 = 4.03 μM. | 20117936 | ||
| GM00637 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human GM00637 cells after 24 hrs by MTT assay, IC50 = 0.9 μM. | 20122765 | ||
| DU145 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human DU145 cells after 72 hrs by MTT assay, IC50 = 0.17 μM. | 20605274 | ||
| HeLa | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HeLa cells after 72 hrs by MTT assay, IC50 = 0.27 μM. | 20605274 | ||
| GM00637 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human GM00637 cells after 72 hrs by MTT assay, IC50 = 0.46 μM. | 20605274 | ||
| DU145 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human DU145 cells assessed as reduction in mean cell viability after 72 hrs by MTT assay, IC50 = 0.17 μM. | 22522008 | ||
| HeLa | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HeLa cells assessed as reduction in mean cell viability after 72 hrs by MTT assay, IC50 = 0.27 μM. | 22522008 | ||
| GM00637 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human GM00637 cells assessed as reduction in mean cell viability after 72 hrs by MTT assay, IC50 = 0.46 μM. | 22522008 | ||
| HL60 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human HL60 cells after 72 hrs by WST8 assay, IC50 = 0.1 μM. | 22537363 | ||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells by MTT assay, IC50 = 3 μM. | 22545792 | |||
| HL60 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HL60 cells after 48 hrs by SRB assay, IC50 = 1.8 μM. | 22642381 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 3.4 μM. | 22642381 | ||
| SMMC7721 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SMMC7721 cells after 48 hrs by SRB assay, IC50 = 5.6 μM. | 22642381 | ||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs by alamar blue assay, IC50 = 0.4 μM. | 23123017 | ||
| HCT116 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HCT116 cells after 48 hrs by sulforhodamine B assay, IC50 = 0.5 μM. | 23501113 | ||
| NCI-H23 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human NCI-H23 cells after 48 hrs by MTT assay, IC50 = 2 μM. | 23792352 | ||
| SPCA1 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SPCA1 cells after 48 hrs by MTT assay, IC50 = 1.68 μM. | 23999045 | ||
| SGC7901 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SGC7901 cells after 48 hrs by MTT assay, IC50 = 2.05 μM. | 23999045 | ||
| PC3 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human PC3 cells after 48 hrs by SRB assay, IC50 = 1.5 μM. | 24056146 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 2 μM. | 24056146 | ||
| MDA-MB-231 | Cytotoxicity assay | 5 days | Cytotoxicity against human MDA-MB-231 cells overexpressing DT-diaphorase after 5 days, EC50 = 0.103 μM. | 24436995 | ||
| MDA-MB-231 | Cytotoxicity assay | 5 days | Cytotoxicity against wild-type human MDA-MB-231 cells after 5 days, EC50 = 1.25 μM. | 24436995 | ||
| HCT15 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HCT15 cells after 48 hrs by sulforhodamine B assay, IC50 = 0.5 μM. | 24910974 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB method, IC50 = 3 μM. | 24913558 | ||
| SMMC-7221 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human SMMC-7221 cells after 48 hrs by SRB method, IC50 = 3 μM. | 24913558 | ||
| HL60 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HL60 cells after 48 hrs by SRB method, IC50 = 3 μM. | 24913558 | ||
| PC3 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human PC3 cells after 48 hrs by SRB assay, IC50 = 1.5 μM. | 25176329 | ||
| HeLa | Cytotoxicity assay | 48 hrs | Cytotoxicity against human HeLa cells after 48 hrs by SRB assay, IC50 = 2 μM. | 25176329 | ||
| A549 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human A549 cells after 48 hrs by SRB assay, IC50 = 0.04 μM. | 25259515 | ||
| THP1 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human THP1 cells after 48 hrs by SRB assay, IC50 = 0.1 μM. | 25259515 | ||
| MCF7 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human MCF7 cells after 48 hrs by SRB assay, IC50 = 0.2 μM. | 25259515 | ||
| A549 | Cytotoxicity assay | 24 hrs | Cytotoxicity against human A549 cells assessed as reduction in cell viability after 24 hrs by WST8 assay, IC50 = 0.45 μM. | 25442306 | ||
| SF539 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human SF539 cells after 72 hrs by MTS assay, IC50 = 0.038 μM. | 26335269 | ||
| M14 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human M14 cells after 72 hrs by MTS assay, IC50 = 0.47 μM. | 26335269 | ||
| MDA-MB-468 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human MDA-MB-468 cells after 72 hrs by MTS assay, IC50 = 0.5 μM. | 26335269 | ||
| SF295 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human SF295 cells after 72 hrs by MTS assay, IC50 = 0.54 μM. | 26335269 | ||
| NCI-H226 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human NCI-H226 cells after 72 hrs by MTS assay, IC50 = 0.58 μM. | 26335269 | ||
| A549 | Cytotoxicity assay | 48 hrs | Cytotoxicity against human A549 cells assessed as decrease in cell viability at 10 to 100 uM after 48 hrs by SRB assay, EC50 = 5.2 μM. | 26508550 | ||
| HUT78 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HUT78 cells after 48 hrs by resazurin reduction assay, IC50 = 0.066 μM. | 26541587 | ||
| Jurkat T | Antiproliferative assay | 48 hrs | Antiproliferative activity against human Jurkat T cells in hypoxic condition after 48 hrs by resazurin reduction assay, IC50 = 0.303 μM. | 26541587 | ||
| HL60 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HL60 cells after 48 hrs by resazurin reduction assay, IC50 = 0.41 μM. | 26541587 | ||
| Jurkat T | Antiproliferative assay | 48 hrs | Antiproliferative activity against human Jurkat T cells after 48 hrs by resazurin reduction assay, IC50 = 0.578 μM. | 26541587 | ||
| HeLa | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HeLa cells after 48 hrs by resazurin reduction assay, IC50 = 1.87 μM. | 26541587 | ||
| HepG2 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HepG2 cells after 48 hrs by resazurin reduction assay, IC50 = 2.937 μM. | 26541587 | ||
| T47D | Antiproliferative assay | 48 hrs | Antiproliferative activity against human T47D cells after 48 hrs by resazurin reduction assay, IC50 = 16.97 μM. | 26541587 | ||
| PC3 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human PC3 cells after 72 hrs by CCK-8 assay, IC50 = 1.4 μM. | 26615890 | ||
| A549 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human A549 cells after 72 hrs by CCK-8 assay, IC50 = 1.7 μM. | 26615890 | ||
| A549 | Cytotoxicity assay | Cytotoxicity against human A549 cells, IC50 = 0.5 μM. | 27089214 | |||
| PC3 | Cytotoxicity assay | Cytotoxicity against human PC3 cells, IC50 = 0.5 μM. | 27089214 | |||
| HT-29 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human HT-29 cells expressing NQO1 after 72 hrs by MTT assay, IC50 = 7.099 μM. | 28395199 | ||
| NCI-H596 | Antiproliferative assay | 72 hrs | Antiproliferative activity against NQO1 deficient human NCI-H596 cells after 72 hrs by MTT assay, IC50 = 11.969 μM. | 28395199 | ||
| A549 | Antiproliferative assay | 72 hrs | Antiproliferative activity against human A549 cells expressing NQO1 after 72 hrs by MTT assay, IC50 = 15.525 μM. | 28395199 | ||
| LO2 | Cytotoxicity assay | 72 hrs | Cytotoxicity against human LO2 cells after 72 hrs by MTT assay, IC50 = 25.023 μM. | 28395199 | ||
| CHOK1 | Cytotoxicity assay | 24 hrs | Cytotoxicity against CHOK1 cells incubated for 24 hrs by MTT asasy, IC50 = 13.2 μM. | 28615134 | ||
| A549 | Growth inhibition assay | 72 hrs | Growth inhibition of human A549 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.08 μM. | 28682609 | ||
| SKOV3 | Growth inhibition assay | 72 hrs | Growth inhibition of human SKOV3 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.1 μM. | 28682609 | ||
| HCT116 | Growth inhibition assay | 72 hrs | Growth inhibition of human HCT116 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.2 μM. | 28682609 | ||
| 786-O | Growth inhibition assay | 72 hrs | Growth inhibition of human 786-O cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.21 μM. | 28682609 | ||
| BxPC3 | Growth inhibition assay | 72 hrs | Growth inhibition of human BxPC3 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 0.38 μM. | 28682609 | ||
| HEC6 | Growth inhibition assay | 72 hrs | Growth inhibition of human HEC6 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 1.4 μM. | 28682609 | ||
| MKN74 | Growth inhibition assay | 72 hrs | Growth inhibition of human MKN74 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 1.7 μM. | 28682609 | ||
| U87MG | Growth inhibition assay | 72 hrs | Growth inhibition of human U87MG cells after 72 hrs by Cell-Titer Glo assay, GI50 = 1.8 μM. | 28682609 | ||
| HuH7 | Growth inhibition assay | 72 hrs | Growth inhibition of human HuH7 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 2 μM. | 28682609 | ||
| MCF7 | Growth inhibition assay | 72 hrs | Growth inhibition of human MCF7 cells after 72 hrs by Cell-Titer Glo assay, GI50 = 2.5 μM. | 28682609 | ||
| MDA-MB-231 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human MDA-MB-231 cells after 48 hrs by MTT assay, IC50 = 4.4 μM. | 29280632 | ||
| HL60 | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HL60 cells after 48 hrs by CCK8 assay, IC50 = 0.19 μM. | 29475587 | ||
| HeLa | Antiproliferative assay | 48 hrs | Antiproliferative activity against human HeLa cells after 48 hrs by CCK8 assay, IC50 = 1.13 μM. | 29475587 | ||
| NTERA-S-cl-D1 | Growth inhibition assay | IC50 = 0.0221 nM | SANGER | |||
| MOLT-4 | Growth inhibition assay | IC50 = 0.0325 nM | SANGER | |||
| J82 | Growth inhibition assay | IC50 = 0.119 nM | SANGER | |||
| 697 | Growth inhibition assay | IC50 = 0.1283 nM | SANGER | |||
| KYSE-510 | Growth inhibition assay | IC50 = 0.1486 nM | SANGER | |||
| NCI-H2170 | Growth inhibition assay | IC50 = 0.1513 nM | SANGER | |||
| BE-13 | Growth inhibition assay | IC50 = 0.1673 nM | SANGER | |||
| LC-2-ad | Growth inhibition assay | IC50 = 0.2492 nM | SANGER | |||
| IMR-5 | Growth inhibition assay | IC50 = 0.3076 nM | SANGER | |||
| EW-16 | Growth inhibition assay | IC50 = 0.31 nM | SANGER | |||
| MC-IXC | Growth inhibition assay | IC50 = 0.638 nM | SANGER | |||
| SW872 | Growth inhibition assay | IC50 = 0.676 nM | SANGER | |||
| NCI-H2228 | Growth inhibition assay | IC50 = 0.7963 nM | SANGER | |||
| NALM-6 | Growth inhibition assay | IC50 = 1.066 nM | SANGER | |||
| ES4 | Growth inhibition assay | IC50 = 1.555 nM | SANGER | |||
| KE-37 | Growth inhibition assay | IC50 = 1.636 nM | SANGER | |||
| IST-MEL1 | Growth inhibition assay | IC50 = 1.684 nM | SANGER | |||
| ES8 | Growth inhibition assay | IC50 = 1.712 nM | SANGER | |||
| MV-4-11 | Growth inhibition assay | IC50 = 1.732 nM | SANGER | |||
| 639-V | Growth inhibition assay | IC50 = 1.759 nM | SANGER | |||
| OCI-AML2 | Growth inhibition assay | IC50 = 1.886 nM | SANGER | |||
| SK-LU-1 | Growth inhibition assay | IC50 = 2.217 nM | SANGER | |||
| REH | Growth inhibition assay | IC50 = 2.548 nM | SANGER | |||
| PSN1 | Growth inhibition assay | IC50 = 2.554 nM | SANGER | |||
| SBC-5 | Growth inhibition assay | IC50 = 2.589 nM | SANGER | |||
| HT-3 | Growth inhibition assay | IC50 = 2.928 nM | SANGER | |||
| SIG-M5 | Growth inhibition assay | IC50 = 3.524 nM | SANGER | |||
| ES7 | Growth inhibition assay | IC50 = 3.653 nM | SANGER | |||
| CHP-212 | Growth inhibition assay | IC50 = 4.368 nM | SANGER | |||
| P12-ICHIKAWA | Growth inhibition assay | IC50 = 4.787 nM | SANGER | |||
| HUTU-80 | Growth inhibition assay | IC50 = 4.83 nM | SANGER | |||
| P30-OHK | Growth inhibition assay | IC50 = 4.842 nM | SANGER | |||
| NCI-H1651 | Growth inhibition assay | IC50 = 4.99 nM | SANGER | |||
| COR-L279 | Growth inhibition assay | IC50 = 5.545 nM | SANGER | |||
| CMK | Growth inhibition assay | IC50 = 5.827 nM | SANGER | |||
| MHH-CALL-2 | Growth inhibition assay | IC50 = 6.06 nM | SANGER | |||
| BV-173 | Growth inhibition assay | IC50 = 6.067 nM | SANGER | |||
| NCI-H209 | Growth inhibition assay | IC50 = 6.168 nM | SANGER | |||
| NCI-H460 | Growth inhibition assay | IC50 = 6.452 nM | SANGER | |||
| DU-145 | Growth inhibition assay | IC50 = 6.519 nM | SANGER | |||
| 769-P | Growth inhibition assay | IC50 = 7.112 nM | SANGER | |||
| ES1 | Growth inhibition assay | IC50 = 7.288 nM | SANGER | |||
| COLO-668 | Growth inhibition assay | IC50 = 7.545 nM | SANGER | |||
| NKM-1 | Growth inhibition assay | IC50 = 7.831 nM | SANGER | |||
| ES3 | Growth inhibition assay | IC50 = 7.882 nM | SANGER | |||
| SCC-3 | Growth inhibition assay | IC50 = 8.519 nM | SANGER | |||
| SU-DHL-1 | Growth inhibition assay | IC50 = 8.609 nM | SANGER | |||
| ML-2 | Growth inhibition assay | IC50 = 8.781 nM | SANGER | |||
| SF295 | Growth inhibition assay | IC50 = 11.48 nM | SANGER | |||
| EW-7 | Growth inhibition assay | IC50 = 12.14 nM | SANGER | |||
| H4 | Growth inhibition assay | IC50 = 12.44 nM | SANGER | |||
| LB2241-RCC | Growth inhibition assay | IC50 = 13.19 nM | SANGER | |||
| SR | Growth inhibition assay | IC50 = 13.46 nM | SANGER | |||
| LB1047-RCC | Growth inhibition assay | IC50 = 13.6 nM | SANGER | |||
| MCF7 | Growth inhibition assay | IC50 = 13.9 nM | SANGER | |||
| ESS-1 | Growth inhibition assay | IC50 = 13.92 nM | SANGER | |||
| NCI-H2122 | Growth inhibition assay | IC50 = 13.96 nM | SANGER | |||
| 786-0 | Growth inhibition assay | IC50 = 14.01 nM | SANGER | |||
| COLO-205 | Growth inhibition assay | IC50 = 14.33 nM | SANGER | |||
| HAL-01 | Growth inhibition assay | IC50 = 15.73 nM | SANGER | |||
| MHH-ES-1 | Growth inhibition assay | IC50 = 16.26 nM | SANGER | |||
| NUGC-3 | Growth inhibition assay | IC50 = 16.95 nM | SANGER | |||
| RPMI-8402 | Growth inhibition assay | IC50 = 17.13 nM | SANGER | |||
| ATN-1 | Growth inhibition assay | IC50 = 17.39 nM | SANGER | |||
| NCI-H441 | Growth inhibition assay | IC50 = 17.6 nM | SANGER | |||
| LB996-RCC | Growth inhibition assay | IC50 = 17.68 nM | SANGER | |||
| CAL-148 | Growth inhibition assay | IC50 = 17.83 nM | SANGER | |||
| CTV-1 | Growth inhibition assay | IC50 = 18.67 nM | SANGER | |||
| HOP-62 | Growth inhibition assay | IC50 = 20.2 nM | SANGER | |||
| CAKI-1 | Growth inhibition assay | IC50 = 23.32 nM | SANGER | |||
| PA-1 | Growth inhibition assay | IC50 = 23.51 nM | SANGER | |||
| HT-144 | Growth inhibition assay | IC50 = 23.75 nM | SANGER | |||
| LOUCY | Growth inhibition assay | IC50 = 26.19 nM | SANGER | |||
| BPH-1 | Growth inhibition assay | IC50 = 29.9 nM | SANGER | |||
| LS-1034 | Growth inhibition assay | IC50 = 30.16 nM | SANGER | |||
| 23132-87 | Growth inhibition assay | IC50 = 30.53 nM | SANGER | |||
| BB30-HNC | Growth inhibition assay | IC50 = 30.61 nM | SANGER | |||
| CAL-51 | Growth inhibition assay | IC50 = 30.86 nM | SANGER | |||
| ALL-PO | Growth inhibition assay | IC50 = 30.98 nM | SANGER | |||
| 5637 | Growth inhibition assay | IC50 = 31.93 nM | SANGER | |||
| KYSE-150 | Growth inhibition assay | IC50 = 34.09 nM | SANGER | |||
| RS4-11 | Growth inhibition assay | IC50 = 34.86 nM | SANGER | |||
| A3-KAW | Growth inhibition assay | IC50 = 34.96 nM | SANGER | |||
| NCI-H719 | Growth inhibition assay | IC50 = 35.12 nM | SANGER | |||
| GI-1 | Growth inhibition assay | IC50 = 35.16 nM | SANGER | |||
| HEL | Growth inhibition assay | IC50 = 35.8 nM | SANGER | |||
| TE-8 | Growth inhibition assay | IC50 = 35.86 nM | SANGER | |||
| HT-29 | Growth inhibition assay | IC50 = 36.02 nM | SANGER | |||
| SW1783 | Growth inhibition assay | IC50 = 38.58 nM | SANGER | |||
| CGTH-W-1 | Growth inhibition assay | IC50 = 38.74 nM | SANGER | |||
| MEL-HO | Growth inhibition assay | IC50 = 39.4 nM | SANGER | |||
| SW620 | Growth inhibition assay | IC50 = 39.79 nM | SANGER | |||
| ME-180 | Growth inhibition assay | IC50 = 40.11 nM | SANGER | |||
| CAL-27 | Growth inhibition assay | IC50 = 41.18 nM | SANGER | |||
| A431 | Growth inhibition assay | IC50 = 43.77 nM | SANGER | |||
| SW954 | Growth inhibition assay | IC50 = 44.91 nM | SANGER | |||
| CAL-39 | Growth inhibition assay | IC50 = 46.49 nM | SANGER | |||
| LU-134-A | Growth inhibition assay | IC50 = 46.72 nM | SANGER | |||
| DU-4475 | Growth inhibition assay | IC50 = 47.47 nM | SANGER | |||
| DEL | Growth inhibition assay | IC50 = 48.39 nM | SANGER | |||
| HGC-27 | Growth inhibition assay | IC50 = 49.29 nM | SANGER | |||
| RH-1 | Growth inhibition assay | IC50 = 49.57 nM | SANGER | |||
| SK-MES-1 | Growth inhibition assay | IC50 = 51.12 nM | SANGER | |||
| MEL-JUSO | Growth inhibition assay | IC50 = 51.25 nM | SANGER | |||
| VA-ES-BJ | Growth inhibition assay | IC50 = 52.16 nM | SANGER | |||
| EW-13 | Growth inhibition assay | IC50 = 52.51 nM | SANGER | |||
| Ca-Ski | Growth inhibition assay | IC50 = 53.75 nM | SANGER | |||
| LXF-289 | Growth inhibition assay | IC50 = 55.37 nM | SANGER | |||
| IM-9 | Growth inhibition assay | IC50 = 56.22 nM | SANGER | |||
| HCE-4 | Growth inhibition assay | IC50 = 57.94 nM | SANGER | |||
| TYK-nu | Growth inhibition assay | IC50 = 58.73 nM | SANGER | |||
| NCI-H748 | Growth inhibition assay | IC50 = 59.54 nM | SANGER | |||
| ABC-1 | Growth inhibition assay | IC50 = 61.2 nM | SANGER | |||
| CCRF-CEM | Growth inhibition assay | IC50 = 61.68 nM | SANGER | |||
| EW-3 | Growth inhibition assay | IC50 = 61.95 nM | SANGER | |||
| NCI-H2342 | Growth inhibition assay | IC50 = 62.51 nM | SANGER | |||
| SK-PN-DW | Growth inhibition assay | IC50 = 63.76 nM | SANGER | |||
| EB2 | Growth inhibition assay | IC50 = 65.36 nM | SANGER | |||
| CAL-85-1 | Growth inhibition assay | IC50 = 65.88 nM | SANGER | |||
| NCI-H526 | Growth inhibition assay | IC50 = 67.37 nM | SANGER | |||
| MFH-ino | Growth inhibition assay | IC50 = 70.61 nM | SANGER | |||
| ACHN | Growth inhibition assay | IC50 = 72.08 nM | SANGER | |||
| MONO-MAC-6 | Growth inhibition assay | IC50 = 72.35 nM | SANGER | |||
| CHP-126 | Growth inhibition assay | IC50 = 72.44 nM | SANGER | |||
| SW1710 | Growth inhibition assay | IC50 = 72.58 nM | SANGER | |||
| TE-10 | Growth inhibition assay | IC50 = 72.6 nM | SANGER | |||
| TE-15 | Growth inhibition assay | IC50 = 73.7 nM | SANGER | |||
| PANC-10-05 | Growth inhibition assay | IC50 = 73.75 nM | SANGER | |||
| BHY | Growth inhibition assay | IC50 = 75.28 nM | SANGER | |||
| HSC-3 | Growth inhibition assay | IC50 = 75.54 nM | SANGER | |||
| COLO-800 | Growth inhibition assay | IC50 = 78.66 nM | SANGER | |||
| NB10 | Growth inhibition assay | IC50 = 81.65 nM | SANGER | |||
| SK-UT-1 | Growth inhibition assay | IC50 = 82.8 nM | SANGER | |||
| HSC-2 | Growth inhibition assay | IC50 = 83.42 nM | SANGER | |||
| GP5d | Growth inhibition assay | IC50 = 84 nM | SANGER | |||
| A204 | Growth inhibition assay | IC50 = 84.19 nM | SANGER | |||
| BFTC-909 | Growth inhibition assay | IC50 = 85.27 nM | SANGER | |||
| NCI-H2087 | Growth inhibition assay | IC50 = 85.69 nM | SANGER | |||
| G-402 | Growth inhibition assay | IC50 = 85.92 nM | SANGER | |||
| 647-V | Growth inhibition assay | IC50 = 87.39 nM | SANGER | |||
| Daoy | Growth inhibition assay | IC50 = 88.01 nM | SANGER | |||
| EW-1 | Growth inhibition assay | IC50 = 88.07 nM | SANGER | |||
| BC-1 | Growth inhibition assay | IC50 = 88.81 nM | SANGER | |||
| OAW-42 | Growth inhibition assay | IC50 = 89.42 nM | SANGER | |||
| COLO-679 | Growth inhibition assay | IC50 = 90.25 nM | SANGER | |||
| TE-11 | Growth inhibition assay | IC50 = 91.77 nM | SANGER | |||
| BFTC-905 | Growth inhibition assay | IC50 = 92.69 nM | SANGER | |||
| KP-4 | Growth inhibition assay | IC50 = 93.15 nM | SANGER | |||
| DOHH-2 | Growth inhibition assay | IC50 = 93.83 nM | SANGER | |||
| L-540 | Growth inhibition assay | IC50 = 95.14 nM | SANGER | |||
| DSH1 | Growth inhibition assay | IC50 = 96.53 nM | SANGER | |||
| M059J | Growth inhibition assay | IC50 = 100.6 nM | SANGER | |||
| UM-UC-3 | Growth inhibition assay | IC50 = 101.83 nM | SANGER | |||
| ES5 | Growth inhibition assay | IC50 = 102.42 nM | SANGER | |||
| KYSE-270 | Growth inhibition assay | IC50 = 102.84 nM | SANGER | |||
| OCUB-M | Growth inhibition assay | IC50 = 102.98 nM | SANGER | |||
| C-4-II | Growth inhibition assay | IC50 = 103.51 nM | SANGER | |||
| BOKU | Growth inhibition assay | IC50 = 103.78 nM | SANGER | |||
| 8-MG-BA | Growth inhibition assay | IC50 = 104 nM | SANGER | |||
| SW982 | Growth inhibition assay | IC50 = 104.73 nM | SANGER | |||
| AGS | Growth inhibition assay | IC50 = 105.8 nM | SANGER | |||
| IGROV-1 | Growth inhibition assay | IC50 = 105.97 nM | SANGER | |||
| HL-60 | Growth inhibition assay | IC50 = 106.06 nM | SANGER | |||
| A2780 | Growth inhibition assay | IC50 = 106.63 nM | SANGER | |||
| HOS | Growth inhibition assay | IC50 = 106.7 nM | SANGER | |||
| HuP-T4 | Growth inhibition assay | IC50 = 108.1 nM | SANGER | |||
| ETK-1 | Growth inhibition assay | IC50 = 108.24 nM | SANGER | |||
| IA-LM | Growth inhibition assay | IC50 = 108.63 nM | SANGER | |||
| MRK-nu-1 | Growth inhibition assay | IC50 = 110.25 nM | SANGER | |||
| SUP-T1 | Growth inhibition assay | IC50 = 110.4 nM | SANGER | |||
| A2058 | Growth inhibition assay | IC50 = 115.1 nM | SANGER | |||
| CAPAN-1 | Growth inhibition assay | IC50 = 116.4 nM | SANGER | |||
| NCI-H1355 | Growth inhibition assay | IC50 = 116.8 nM | SANGER | |||
| NCI-H1618 | Growth inhibition assay | IC50 = 117.76 nM | SANGER | |||
| QIMR-WIL | Growth inhibition assay | IC50 = 119.58 nM | SANGER | |||
| HCC1599 | Growth inhibition assay | IC50 = 120.17 nM | SANGER | |||
| GR-ST | Growth inhibition assay | IC50 = 121.34 nM | SANGER | |||
| G-361 | Growth inhibition assay | IC50 = 123.93 nM | SANGER | |||
| RKO | Growth inhibition assay | IC50 = 125.29 nM | SANGER | |||
| NCI-H1437 | Growth inhibition assay | IC50 = 126.26 nM | SANGER | |||
| SF539 | Growth inhibition assay | IC50 = 127.02 nM | SANGER | |||
| ACN | Growth inhibition assay | IC50 = 127.91 nM | SANGER | |||
| FADU | Growth inhibition assay | IC50 = 128.29 nM | SANGER | |||
| U251 | Growth inhibition assay | IC50 = 128.73 nM | SANGER | |||
| KALS-1 | Growth inhibition assay | IC50 = 129.14 nM | SANGER | |||
| KM-H2 | Growth inhibition assay | IC50 = 130.45 nM | SANGER | |||
| SJSA-1 | Growth inhibition assay | IC50 = 131.56 nM | SANGER | |||
| TE-5 | Growth inhibition assay | IC50 = 132.24 nM | SANGER | |||
| SNG-M | Growth inhibition assay | IC50 = 134.17 nM | SANGER | |||
| HCC1806 | Growth inhibition assay | IC50 = 134.54 nM | SANGER | |||
| NCI-H1734 | Growth inhibition assay | IC50 = 136.85 nM | SANGER | |||
| LCLC-97TM1 | Growth inhibition assay | IC50 = 138.72 nM | SANGER | |||
| NH-12 | Growth inhibition assay | IC50 = 139.13 nM | SANGER | |||
| A375 | Growth inhibition assay | IC50 = 139.42 nM | SANGER | |||
| NCI-SNU-5 | Growth inhibition assay | IC50 = 141.21 nM | SANGER | |||
| SK-OV-3 | Growth inhibition assay | IC50 = 142.64 nM | SANGER | |||
| 22RV1 | Growth inhibition assay | IC50 = 144.07 nM | SANGER | |||
| SW1573 | Growth inhibition assay | IC50 = 144.68 nM | SANGER | |||
| BB65-RCC | Growth inhibition assay | IC50 = 144.71 nM | SANGER | |||
| MES-SA | Growth inhibition assay | IC50 = 144.94 nM | SANGER | |||
| K052 | Growth inhibition assay | IC50 = 149.34 nM | SANGER | |||
| KU812 | Growth inhibition assay | IC50 = 149.96 nM | SANGER | |||
| NOMO-1 | Growth inhibition assay | IC50 = 151.41 nM | SANGER | |||
| Ca9-22 | Growth inhibition assay | IC50 = 155.57 nM | SANGER | |||
| 8305C | Growth inhibition assay | IC50 = 155.75 nM | SANGER | |||
| NCI-SNU-1 | Growth inhibition assay | IC50 = 156.24 nM | SANGER | |||
| HC-1 | Growth inhibition assay | IC50 = 156.51 nM | SANGER | |||
| SW962 | Growth inhibition assay | IC50 = 157.55 nM | SANGER | |||
| HCC2998 | Growth inhibition assay | IC50 = 160.13 nM | SANGER | |||
| DMS-273 | Growth inhibition assay | IC50 = 160.83 nM | SANGER | |||
| MC-CAR | Growth inhibition assay | IC50 = 160.91 nM | SANGER | |||
| Caov-3 | Growth inhibition assay | IC50 = 161.72 nM | SANGER | |||
| EoL-1-cell | Growth inhibition assay | IC50 = 162.39 nM | SANGER | |||
| MKN45 | Growth inhibition assay | IC50 = 165.04 nM | SANGER | |||
| TE-1 | Growth inhibition assay | IC50 = 165.38 nM | SANGER | |||
| HMV-II | Growth inhibition assay | IC50 = 166.06 nM | SANGER | |||
| SK-NEP-1 | Growth inhibition assay | IC50 = 166.53 nM | SANGER | |||
| PANC-03-27 | Growth inhibition assay | IC50 = 167.16 nM | SANGER | |||
| RPMI-7951 | Growth inhibition assay | IC50 = 167.55 nM | SANGER | |||
| NCI-H520 | Growth inhibition assay | IC50 = 168.65 nM | SANGER | |||
| NCI-H522 | Growth inhibition assay | IC50 = 169.45 nM | SANGER | |||
| Detroit562 | Growth inhibition assay | IC50 = 170.26 nM | SANGER | |||
| SF268 | Growth inhibition assay | IC50 = 170.86 nM | SANGER | |||
| T84 | Growth inhibition assay | IC50 = 173.34 nM | SANGER | |||
| NB69 | Growth inhibition assay | IC50 = 175.06 nM | SANGER | |||
| OVCAR-8 | Growth inhibition assay | IC50 = 175.54 nM | SANGER | |||
| RT-112 | Growth inhibition assay | IC50 = 177.98 nM | SANGER | |||
| DoTc2-4510 | Growth inhibition assay | IC50 = 180.37 nM | SANGER | |||
| J-RT3-T3-5 | Growth inhibition assay | IC50 = 185.8 nM | SANGER | |||
| NB1 | Growth inhibition assay | IC50 = 186.61 nM | SANGER | |||
| NEC8 | Growth inhibition assay | IC50 = 186.77 nM | SANGER | |||
| TUR | Growth inhibition assay | IC50 = 189.67 nM | SANGER | |||
| TE-12 | Growth inhibition assay | IC50 = 189.83 nM | SANGER | |||
| WSU-NHL | Growth inhibition assay | IC50 = 192.04 nM | SANGER | |||
| MHH-NB-11 | Growth inhibition assay | IC50 = 192.55 nM | SANGER | |||
| SW48 | Growth inhibition assay | IC50 = 193.36 nM | SANGER | |||
| C3A | Growth inhibition assay | IC50 = 194.31 nM | SANGER | |||
| RPMI-2650 | Growth inhibition assay | IC50 = 195.75 nM | SANGER | |||
| VMRC-RCZ | Growth inhibition assay | IC50 = 198.77 nM | SANGER | |||
| SK-CO-1 | Growth inhibition assay | IC50 = 0.20181 μM | SANGER | |||
| KYSE-180 | Growth inhibition assay | IC50 = 0.20219 μM | SANGER | |||
| KGN | Growth inhibition assay | IC50 = 0.20713 μM | SANGER | |||
| A388 | Growth inhibition assay | IC50 = 0.20722 μM | SANGER | |||
| NCI-H2030 | Growth inhibition assay | IC50 = 0.21132 μM | SANGER | |||
| NCI-H727 | Growth inhibition assay | IC50 = 0.2118 μM | SANGER | |||
| BC-3 | Growth inhibition assay | IC50 = 0.21208 μM | SANGER | |||
| CCF-STTG1 | Growth inhibition assay | IC50 = 0.21559 μM | SANGER | |||
| NMC-G1 | Growth inhibition assay | IC50 = 0.21675 μM | SANGER | |||
| NCI-H1299 | Growth inhibition assay | IC50 = 0.21841 μM | SANGER | |||
| RPMI-6666 | Growth inhibition assay | IC50 = 0.21961 μM | SANGER | |||
| D-283MED | Growth inhibition assay | IC50 = 0.22069 μM | SANGER | |||
| AM-38 | Growth inhibition assay | IC50 = 0.22116 μM | SANGER | |||
| LU-99A | Growth inhibition assay | IC50 = 0.22424 μM | SANGER | |||
| KYSE-70 | Growth inhibition assay | IC50 = 0.22431 μM | SANGER | |||
| CHL-1 | Growth inhibition assay | IC50 = 0.22516 μM | SANGER | |||
| CESS | Growth inhibition assay | IC50 = 0.2254 μM | SANGER | |||
| A4-Fuk | Growth inhibition assay | IC50 = 0.22543 μM | SANGER | |||
| MG-63 | Growth inhibition assay | IC50 = 0.22618 μM | SANGER | |||
| MKN28 | Growth inhibition assay | IC50 = 0.23009 μM | SANGER | |||
| NCI-H1417 | Growth inhibition assay | IC50 = 0.2369 μM | SANGER | |||
| BCPAP | Growth inhibition assay | IC50 = 0.2396 μM | SANGER | |||
| COR-L23 | Growth inhibition assay | IC50 = 0.24094 μM | SANGER | |||
| SIMA | Growth inhibition assay | IC50 = 0.24142 μM | SANGER | |||
| CAL-62 | Growth inhibition assay | IC50 = 0.24185 μM | SANGER | |||
| ARH-77 | Growth inhibition assay | IC50 = 0.24331 μM | SANGER | |||
| COLO-680N | Growth inhibition assay | IC50 = 0.2441 μM | SANGER | |||
| T-24 | Growth inhibition assay | IC50 = 0.24577 μM | SANGER | |||
| PF-382 | Growth inhibition assay | IC50 = 0.25063 μM | SANGER | |||
| NCI-H810 | Growth inhibition assay | IC50 = 0.25161 μM | SANGER | |||
| NCI-H1882 | Growth inhibition assay | IC50 = 0.25709 μM | SANGER | |||
| A101D | Growth inhibition assay | IC50 = 0.25745 μM | SANGER | |||
| NCI-H2126 | Growth inhibition assay | IC50 = 0.2602 μM | SANGER | |||
| VM-CUB-1 | Growth inhibition assay | IC50 = 0.26082 μM | SANGER | |||
| OS-RC-2 | Growth inhibition assay | IC50 = 0.2637 μM | SANGER | |||
| MIA-PaCa-2 | Growth inhibition assay | IC50 = 0.27545 μM | SANGER | |||
| SW837 | Growth inhibition assay | IC50 = 0.27613 μM | SANGER | |||
| NCI-H358 | Growth inhibition assay | IC50 = 0.27626 μM | SANGER | |||
| NCI-H1703 | Growth inhibition assay | IC50 = 0.27688 μM | SANGER | |||
| NCI-H1650 | Growth inhibition assay | IC50 = 0.28257 μM | SANGER | |||
| SW626 | Growth inhibition assay | IC50 = 0.28622 μM | SANGER | |||
| MFE-296 | Growth inhibition assay | IC50 = 0.28623 μM | SANGER | |||
| NCI-H2009 | Growth inhibition assay | IC50 = 0.28857 μM | SANGER | |||
| NCI-H2405 | Growth inhibition assay | IC50 = 0.29434 μM | SANGER | |||
| BL-41 | Growth inhibition assay | IC50 = 0.2949 μM | SANGER | |||
| SNU-C2B | Growth inhibition assay | IC50 = 0.29505 μM | SANGER | |||
| no-10 | Growth inhibition assay | IC50 = 0.2996 μM | SANGER | |||
| A427 | Growth inhibition assay | IC50 = 0.30133 μM | SANGER | |||
| SNB75 | Growth inhibition assay | IC50 = 0.30346 μM | SANGER | |||
| CTB-1 | Growth inhibition assay | IC50 = 0.30637 μM | SANGER | |||
| BT-20 | Growth inhibition assay | IC50 = 0.31197 μM | SANGER | |||
| GT3TKB | Growth inhibition assay | IC50 = 0.31823 μM | SANGER | |||
| COR-L88 | Growth inhibition assay | IC50 = 0.31914 μM | SANGER | |||
| Calu-6 | Growth inhibition assay | IC50 = 0.31971 μM | SANGER | |||
| Calu-3 | Growth inhibition assay | IC50 = 0.32095 μM | SANGER | |||
| IGR-1 | Growth inhibition assay | IC50 = 0.3216 μM | SANGER | |||
| LS-411N | Growth inhibition assay | IC50 = 0.32176 μM | SANGER | |||
| LAN-6 | Growth inhibition assay | IC50 = 0.32779 μM | SANGER | |||
| ONS-76 | Growth inhibition assay | IC50 = 0.32956 μM | SANGER | |||
| MZ7-mel | Growth inhibition assay | IC50 = 0.33256 μM | SANGER | |||
| LB647-SCLC | Growth inhibition assay | IC50 = 0.33608 μM | SANGER | |||
| OE33 | Growth inhibition assay | IC50 = 0.3378 μM | SANGER | |||
| NCI-H1770 | Growth inhibition assay | IC50 = 0.34265 μM | SANGER | |||
| MS-1 | Growth inhibition assay | IC50 = 0.34402 μM | SANGER | |||
| NCI-H650 | Growth inhibition assay | IC50 = 0.34407 μM | SANGER | |||
| MDA-MB-468 | Growth inhibition assay | IC50 = 0.34531 μM | SANGER | |||
| A253 | Growth inhibition assay | IC50 = 0.34564 μM | SANGER | |||
| LOXIMVI | Growth inhibition assay | IC50 = 0.3525 μM | SANGER | |||
| BB49-HNC | Growth inhibition assay | IC50 = 0.35252 μM | SANGER | |||
| HT-1080 | Growth inhibition assay | IC50 = 0.35371 μM | SANGER | |||
| NB5 | Growth inhibition assay | IC50 = 0.3579 μM | SANGER | |||
| LK-2 | Growth inhibition assay | IC50 = 0.35814 μM | SANGER | |||
| KS-1 | Growth inhibition assay | IC50 = 0.36415 μM | SANGER | |||
| OE19 | Growth inhibition assay | IC50 = 0.36496 μM | SANGER | |||
| U031 | Growth inhibition assay | IC50 = 0.3658 μM | SANGER | |||
| HCE-T | Growth inhibition assay | IC50 = 0.37153 μM | SANGER | |||
| NCI-H1304 | Growth inhibition assay | IC50 = 0.37523 μM | SANGER | |||
| SKG-IIIa | Growth inhibition assay | IC50 = 0.37738 μM | SANGER | |||
| GDM-1 | Growth inhibition assay | IC50 = 0.37746 μM | SANGER | |||
| CPC-N | Growth inhibition assay | IC50 = 0.38066 μM | SANGER | |||
| KYSE-140 | Growth inhibition assay | IC50 = 0.38134 μM | SANGER | |||
| SH-4 | Growth inhibition assay | IC50 = 0.38726 μM | SANGER | |||
| IST-SL2 | Growth inhibition assay | IC50 = 0.38762 μM | SANGER | |||
| SCC-4 | Growth inhibition assay | IC50 = 0.3877 μM | SANGER | |||
| OMC-1 | Growth inhibition assay | IC50 = 0.38955 μM | SANGER | |||
| Daudi | Growth inhibition assay | IC50 = 0.39242 μM | SANGER | |||
| JVM-2 | Growth inhibition assay | IC50 = 0.39734 μM | SANGER | |||
| NCI-H510A | Growth inhibition assay | IC50 = 0.40282 μM | SANGER | |||
| NCI-H1838 | Growth inhibition assay | IC50 = 0.40419 μM | SANGER | |||
| GCIY | Growth inhibition assay | IC50 = 0.41099 μM | SANGER | |||
| NCI-H747 | Growth inhibition assay | IC50 = 0.41159 μM | SANGER | |||
| NCI-H1694 | Growth inhibition assay | IC50 = 0.41528 μM | SANGER | |||
| UACC-893 | Growth inhibition assay | IC50 = 0.41801 μM | SANGER | |||
| DMS-153 | Growth inhibition assay | IC50 = 0.42526 μM | SANGER | |||
| GAMG | Growth inhibition assay | IC50 = 0.42821 μM | SANGER | |||
| LB373-MEL-D | Growth inhibition assay | IC50 = 0.42962 μM | SANGER | |||
| 8505C | Growth inhibition assay | IC50 = 0.42983 μM | SANGER | |||
| DB | Growth inhibition assay | IC50 = 0.42995 μM | SANGER | |||
| LoVo | Growth inhibition assay | IC50 = 0.43068 μM | SANGER | |||
| MZ2-MEL | Growth inhibition assay | IC50 = 0.43247 μM | SANGER | |||
| L-363 | Growth inhibition assay | IC50 = 0.43417 μM | SANGER | |||
| HSC-4 | Growth inhibition assay | IC50 = 0.43445 μM | SANGER | |||
| NCI-N87 | Growth inhibition assay | IC50 = 0.43812 μM | SANGER | |||
| SK-LMS-1 | Growth inhibition assay | IC50 = 0.43929 μM | SANGER | |||
| HO-1-N-1 | Growth inhibition assay | IC50 = 0.44064 μM | SANGER | |||
| OAW-28 | Growth inhibition assay | IC50 = 0.44065 μM | SANGER | |||
| SBC-1 | Growth inhibition assay | IC50 = 0.4477 μM | SANGER | |||
| LNCaP-Clone-FGC | Growth inhibition assay | IC50 = 0.45008 μM | SANGER | |||
| MZ1-PC | Growth inhibition assay | IC50 = 0.45011 μM | SANGER | |||
| GB-1 | Growth inhibition assay | IC50 = 0.45218 μM | SANGER | |||
| LCLC-103H | Growth inhibition assay | IC50 = 0.46087 μM | SANGER | |||
| YT | Growth inhibition assay | IC50 = 0.46333 μM | SANGER | |||
| HCT-15 | Growth inhibition assay | IC50 = 0.46462 μM | SANGER | |||
| CaR-1 | Growth inhibition assay | IC50 = 0.46878 μM | SANGER | |||
| SK-MEL-30 | Growth inhibition assay | IC50 = 0.47431 μM | SANGER | |||
| TCCSUP | Growth inhibition assay | IC50 = 0.4817 μM | SANGER | |||
| C-33-A | Growth inhibition assay | IC50 = 0.48687 μM | SANGER | |||
| OVCAR-5 | Growth inhibition assay | IC50 = 0.48711 μM | SANGER | |||
| CAL-12T | Growth inhibition assay | IC50 = 0.49125 μM | SANGER | |||
| PC-14 | Growth inhibition assay | IC50 = 0.49127 μM | SANGER | |||
| ST486 | Growth inhibition assay | IC50 = 0.49436 μM | SANGER | |||
| HLE | Growth inhibition assay | IC50 = 0.49832 μM | SANGER | |||
| TE-9 | Growth inhibition assay | IC50 = 0.50049 μM | SANGER | |||
| AU565 | Growth inhibition assay | IC50 = 0.50096 μM | SANGER | |||
| LU-165 | Growth inhibition assay | IC50 = 0.51311 μM | SANGER | |||
| EW-11 | Growth inhibition assay | IC50 = 0.51336 μM | SANGER | |||
| FTC-133 | Growth inhibition assay | IC50 = 0.51722 μM | SANGER | |||
| NCI-H1648 | Growth inhibition assay | IC50 = 0.52301 μM | SANGER | |||
| AN3-CA | Growth inhibition assay | IC50 = 0.52328 μM | SANGER | |||
| KURAMOCHI | Growth inhibition assay | IC50 = 0.52344 μM | SANGER | |||
| T98G | Growth inhibition assay | IC50 = 0.52375 μM | SANGER | |||
| TK10 | Growth inhibition assay | IC50 = 0.52832 μM | SANGER | |||
| LB2518-MEL | Growth inhibition assay | IC50 = 0.53456 μM | SANGER | |||
| CAL-33 | Growth inhibition assay | IC50 = 0.53653 μM | SANGER | |||
| A172 | Growth inhibition assay | IC50 = 0.53752 μM | SANGER | |||
| D-263MG | Growth inhibition assay | IC50 = 0.54004 μM | SANGER | |||
| CAMA-1 | Growth inhibition assay | IC50 = 0.54059 μM | SANGER | |||
| MKN1 | Growth inhibition assay | IC50 = 0.54081 μM | SANGER | |||
| NCI-H661 | Growth inhibition assay | IC50 = 0.54158 μM | SANGER | |||
| YKG-1 | Growth inhibition assay | IC50 = 0.545 μM | SANGER | |||
| GOTO | Growth inhibition assay | IC50 = 0.55371 μM | SANGER | |||
| KYSE-450 | Growth inhibition assay | IC50 = 0.56311 μM | SANGER | |||
| UMC-11 | Growth inhibition assay | IC50 = 0.56701 μM | SANGER | |||
| DBTRG-05MG | Growth inhibition assay | IC50 = 0.57026 μM | SANGER | |||
| KYSE-410 | Growth inhibition assay | IC50 = 0.58359 μM | SANGER | |||
| MOLT-16 | Growth inhibition assay | IC50 = 0.58519 μM | SANGER | |||
| HCC2218 | Growth inhibition assay | IC50 = 0.58882 μM | SANGER | |||
| EFO-21 | Growth inhibition assay | IC50 = 0.59114 μM | SANGER | |||
| S-117 | Growth inhibition assay | IC50 = 0.59244 μM | SANGER | |||
| HCC1937 | Growth inhibition assay | IC50 = 0.59382 μM | SANGER | |||
| THP-1 | Growth inhibition assay | IC50 = 0.5955 μM | SANGER | |||
| GAK | Growth inhibition assay | IC50 = 0.59624 μM | SANGER | |||
| SW756 | Growth inhibition assay | IC50 = 0.59691 μM | SANGER | |||
| KG-1 | Growth inhibition assay | IC50 = 0.59714 μM | SANGER | |||
| D-542MG | Growth inhibition assay | IC50 = 0.60165 μM | SANGER | |||
| HCC38 | Growth inhibition assay | IC50 = 0.60411 μM | SANGER | |||
| SAS | Growth inhibition assay | IC50 = 0.61465 μM | SANGER | |||
| RVH-421 | Growth inhibition assay | IC50 = 0.62917 μM | SANGER | |||
| JiyoyeP-2003 | Growth inhibition assay | IC50 = 0.62954 μM | SANGER | |||
| G-401 | Growth inhibition assay | IC50 = 0.63447 μM | SANGER | |||
| SW1990 | Growth inhibition assay | IC50 = 0.63705 μM | SANGER | |||
| KP-N-YS | Growth inhibition assay | IC50 = 0.64012 μM | SANGER | |||
| HD-MY-Z | Growth inhibition assay | IC50 = 0.64025 μM | SANGER | |||
| LAMA-84 | Growth inhibition assay | IC50 = 0.64166 μM | SANGER | |||
| SW13 | Growth inhibition assay | IC50 = 0.64249 μM | SANGER | |||
| HCC1569 | Growth inhibition assay | IC50 = 0.64461 μM | SANGER | |||
| CP66-MEL | Growth inhibition assay | IC50 = 0.64495 μM | SANGER | |||
| SK-HEP-1 | Growth inhibition assay | IC50 = 0.64566 μM | SANGER | |||
| NB13 | Growth inhibition assay | IC50 = 0.64603 μM | SANGER | |||
| NY | Growth inhibition assay | IC50 = 0.65739 μM | SANGER | |||
| EHEB | Growth inhibition assay | IC50 = 0.67213 μM | SANGER | |||
| MEG-01 | Growth inhibition assay | IC50 = 0.68336 μM | SANGER | |||
| HCC70 | Growth inhibition assay | IC50 = 0.69433 μM | SANGER | |||
| OVCAR-4 | Growth inhibition assay | IC50 = 0.69691 μM | SANGER | |||
| NCI-H1792 | Growth inhibition assay | IC50 = 0.69734 μM | SANGER | |||
| HEC-1 | Growth inhibition assay | IC50 = 0.69824 μM | SANGER | |||
| NCI-H187 | Growth inhibition assay | IC50 = 0.70799 μM | SANGER | |||
| TGBC24TKB | Growth inhibition assay | IC50 = 0.71 μM | SANGER | |||
| HuP-T3 | Growth inhibition assay | IC50 = 0.71055 μM | SANGER | |||
| SK-MEL-3 | Growth inhibition assay | IC50 = 0.71112 μM | SANGER | |||
| MDA-MB-415 | Growth inhibition assay | IC50 = 0.72395 μM | SANGER | |||
| HCC2157 | Growth inhibition assay | IC50 = 0.72685 μM | SANGER | |||
| NCI-H2081 | Growth inhibition assay | IC50 = 0.74057 μM | SANGER | |||
| ES6 | Growth inhibition assay | IC50 = 0.74562 μM | SANGER | |||
| KYSE-520 | Growth inhibition assay | IC50 = 0.77218 μM | SANGER | |||
| BxPC-3 | Growth inhibition assay | IC50 = 0.77478 μM | SANGER | |||
| NCI-H226 | Growth inhibition assay | IC50 = 0.77721 μM | SANGER | |||
| LB771-HNC | Growth inhibition assay | IC50 = 0.77974 μM | SANGER | |||
| CP50-MEL-B | Growth inhibition assay | IC50 = 0.78003 μM | SANGER | |||
| HN | Growth inhibition assay | IC50 = 0.78254 μM | SANGER | |||
| EW-24 | Growth inhibition assay | IC50 = 0.78297 μM | SANGER | |||
| A673 | Growth inhibition assay | IC50 = 0.7896 μM | SANGER | |||
| COLO-684 | Growth inhibition assay | IC50 = 0.7993 μM | SANGER | |||
| DMS-53 | Growth inhibition assay | IC50 = 0.80856 μM | SANGER | |||
| MDA-MB-361 | Growth inhibition assay | IC50 = 0.80898 μM | SANGER | |||
| SNU-475 | Growth inhibition assay | IC50 = 0.81314 μM | SANGER | |||
| LB831-BLC | Growth inhibition assay | IC50 = 0.81608 μM | SANGER | |||
| RCM-1 | Growth inhibition assay | IC50 = 0.84728 μM | SANGER | |||
| NCI-H2347 | Growth inhibition assay | IC50 = 0.84997 μM | SANGER | |||
| NCI-H2141 | Growth inhibition assay | IC50 = 0.85281 μM | SANGER | |||
| Becker | Growth inhibition assay | IC50 = 0.86232 μM | SANGER | |||
| LC-1F | Growth inhibition assay | IC50 = 0.86233 μM | SANGER | |||
| SCC-15 | Growth inhibition assay | IC50 = 0.86386 μM | SANGER | |||
| U-266 | Growth inhibition assay | IC50 = 0.86618 μM | SANGER | |||
| SCC-25 | Growth inhibition assay | IC50 = 0.87036 μM | SANGER | |||
| NCI-H1155 | Growth inhibition assay | IC50 = 0.87336 μM | SANGER | |||
| NCI-H292 | Growth inhibition assay | IC50 = 0.88441 μM | SANGER | |||
| NCI-H2196 | Growth inhibition assay | IC50 = 0.886 μM | SANGER | |||
| EKVX | Growth inhibition assay | IC50 = 0.893 μM | SANGER | |||
| TE-6 | Growth inhibition assay | IC50 = 0.89367 μM | SANGER | |||
| NCI-H1693 | Growth inhibition assay | IC50 = 0.89963 μM | SANGER | |||
| HuCCT1 | Growth inhibition assay | IC50 = 0.90351 μM | SANGER | |||
| NCI-H1581 | Growth inhibition assay | IC50 = 0.90674 μM | SANGER | |||
| KARPAS-422 | Growth inhibition assay | IC50 = 0.90739 μM | SANGER | |||
| C8166 | Growth inhibition assay | IC50 = 0.93232 μM | SANGER | |||
| BEN | Growth inhibition assay | IC50 = 0.93516 μM | SANGER | |||
| SCLC-21H | Growth inhibition assay | IC50 = 0.96303 μM | SANGER | |||
| HT-1376 | Growth inhibition assay | IC50 = 0.96711 μM | SANGER | |||
| NCI-H1963 | Growth inhibition assay | IC50 = 0.97437 μM | SANGER | |||
| MPP-89 | Growth inhibition assay | IC50 = 0.99122 μM | SANGER | |||
| SW1417 | Growth inhibition assay | IC50 = 1.00545 μM | SANGER | |||
| NCCIT | Growth inhibition assay | IC50 = 1.01024 μM | SANGER | |||
| MMAC-SF | Growth inhibition assay | IC50 = 1.01163 μM | SANGER | |||
| LU-65 | Growth inhibition assay | IC50 = 1.01247 μM | SANGER | |||
| NCI-H1623 | Growth inhibition assay | IC50 = 1.01428 μM | SANGER | |||
| HCT-116 | Growth inhibition assay | IC50 = 1.01502 μM | SANGER | |||
| CA46 | Growth inhibition assay | IC50 = 1.0198 μM | SANGER | |||
| RERF-LC-MS | Growth inhibition assay | IC50 = 1.03157 μM | SANGER | |||
| DJM-1 | Growth inhibition assay | IC50 = 1.03304 μM | SANGER | |||
| EM-2 | Growth inhibition assay | IC50 = 1.03374 μM | SANGER | |||
| HCC1395 | Growth inhibition assay | IC50 = 1.05754 μM | SANGER | |||
| HCC1143 | Growth inhibition assay | IC50 = 1.0664 μM | SANGER | |||
| HH | Growth inhibition assay | IC50 = 1.0738 μM | SANGER | |||
| MDA-MB-453 | Growth inhibition assay | IC50 = 1.07917 μM | SANGER | |||
| COLO-320-HSR | Growth inhibition assay | IC50 = 1.0792 μM | SANGER | |||
| KM12 | Growth inhibition assay | IC50 = 1.08364 μM | SANGER | |||
| KNS-42 | Growth inhibition assay | IC50 = 1.09239 μM | SANGER | |||
| HPAF-II | Growth inhibition assay | IC50 = 1.09715 μM | SANGER | |||
| OVCAR-3 | Growth inhibition assay | IC50 = 1.12787 μM | SANGER | |||
| EFO-27 | Growth inhibition assay | IC50 = 1.13122 μM | SANGER | |||
| L-428 | Growth inhibition assay | IC50 = 1.15778 μM | SANGER | |||
| LS-513 | Growth inhibition assay | IC50 = 1.17808 μM | SANGER | |||
| NB12 | Growth inhibition assay | IC50 = 1.20371 μM | SANGER | |||
| NCI-H23 | Growth inhibition assay | IC50 = 1.20661 μM | SANGER | |||
| TGBC1TKB | Growth inhibition assay | IC50 = 1.21141 μM | SANGER | |||
| LU-139 | Growth inhibition assay | IC50 = 1.21841 μM | SANGER | |||
| Raji | Growth inhibition assay | IC50 = 1.22094 μM | SANGER | |||
| IPC-298 | Growth inhibition assay | IC50 = 1.22841 μM | SANGER | |||
| NCI-H838 | Growth inhibition assay | IC50 = 1.23291 μM | SANGER | |||
| RPMI-8226 | Growth inhibition assay | IC50 = 1.23847 μM | SANGER | |||
| LC4-1 | Growth inhibition assay | IC50 = 1.23959 μM | SANGER | |||
| MN-60 | Growth inhibition assay | IC50 = 1.26332 μM | SANGER | |||
| U-87-MG | Growth inhibition assay | IC50 = 1.27372 μM | SANGER | |||
| BL-70 | Growth inhibition assay | IC50 = 1.27667 μM | SANGER | |||
| MLMA | Growth inhibition assay | IC50 = 1.30978 μM | SANGER | |||
| RPMI-8866 | Growth inhibition assay | IC50 = 1.31777 μM | SANGER | |||
| M14 | Growth inhibition assay | IC50 = 1.3376 μM | SANGER | |||
| RCC10RGB | Growth inhibition assay | IC50 = 1.34936 μM | SANGER | |||
| SK-MEL-24 | Growth inhibition assay | IC50 = 1.37423 μM | SANGER | |||
| SHP-77 | Growth inhibition assay | IC50 = 1.3783 μM | SANGER | |||
| EFE-184 | Growth inhibition assay | IC50 = 1.38125 μM | SANGER | |||
| GI-ME-N | Growth inhibition assay | IC50 = 1.39089 μM | SANGER | |||
| SF126 | Growth inhibition assay | IC50 = 1.40565 μM | SANGER | |||
| Saos-2 | Growth inhibition assay | IC50 = 1.40649 μM | SANGER | |||
| KARPAS-299 | Growth inhibition assay | IC50 = 1.41651 μM | SANGER | |||
| MC116 | Growth inhibition assay | IC50 = 1.41664 μM | SANGER | |||
| NCI-H1563 | Growth inhibition assay | IC50 = 1.42784 μM | SANGER | |||
| COLO-824 | Growth inhibition assay | IC50 = 1.44461 μM | SANGER | |||
| IST-SL1 | Growth inhibition assay | IC50 = 1.4462 μM | SANGER | |||
| HDLM-2 | Growth inhibition assay | IC50 = 1.4601 μM | SANGER | |||
| NCI-H1573 | Growth inhibition assay | IC50 = 1.46085 μM | SANGER | |||
| NCI-H2171 | Growth inhibition assay | IC50 = 1.49785 μM | SANGER | |||
| NOS-1 | Growth inhibition assay | IC50 = 1.50227 μM | SANGER | |||
| COLO-792 | Growth inhibition assay | IC50 = 1.50264 μM | SANGER | |||
| SNU-423 | Growth inhibition assay | IC50 = 1.52181 μM | SANGER | |||
| C32 | Growth inhibition assay | IC50 = 1.52834 μM | SANGER | |||
| KOSC-2 | Growth inhibition assay | IC50 = 1.53103 μM | SANGER | |||
| NCI-H64 | Growth inhibition assay | IC50 = 1.53444 μM | SANGER | |||
| HT | Growth inhibition assay | IC50 = 1.53659 μM | SANGER | |||
| NCI-H596 | Growth inhibition assay | IC50 = 1.5377 μM | SANGER | |||
| NCI-H720 | Growth inhibition assay | IC50 = 1.54425 μM | SANGER | |||
| UACC-257 | Growth inhibition assay | IC50 = 1.56566 μM | SANGER | |||
| EVSA-T | Growth inhibition assay | IC50 = 1.57368 μM | SANGER | |||
| KNS-81-FD | Growth inhibition assay | IC50 = 1.59446 μM | SANGER | |||
| TE-441-T | Growth inhibition assay | IC50 = 1.60276 μM | SANGER | |||
| U-698-M | Growth inhibition assay | IC50 = 1.60291 μM | SANGER | |||
| COR-L105 | Growth inhibition assay | IC50 = 1.61317 μM | SANGER | |||
| KMOE-2 | Growth inhibition assay | IC50 = 1.62413 μM | SANGER | |||
| KY821 | Growth inhibition assay | IC50 = 1.65078 μM | SANGER | |||
| SJRH30 | Growth inhibition assay | IC50 = 1.6742 μM | SANGER | |||
| NCI-H69 | Growth inhibition assay | IC50 = 1.67882 μM | SANGER | |||
| RT4 | Growth inhibition assay | IC50 = 1.69923 μM | SANGER | |||
| LS-123 | Growth inhibition assay | IC50 = 1.72001 μM | SANGER | |||
| BHT-101 | Growth inhibition assay | IC50 = 1.74029 μM | SANGER | |||
| K5 | Growth inhibition assay | IC50 = 1.78398 μM | SANGER | |||
| SK-N-AS | Growth inhibition assay | IC50 = 1.79073 μM | SANGER | |||
| NCI-H322M | Growth inhibition assay | IC50 = 1.80152 μM | SANGER | |||
| NCI-H1793 | Growth inhibition assay | IC50 = 1.81482 μM | SANGER | |||
| CAL-54 | Growth inhibition assay | IC50 = 1.84148 μM | SANGER | |||
| SK-MEL-1 | Growth inhibition assay | IC50 = 1.88815 μM | SANGER | |||
| SiHa | Growth inhibition assay | IC50 = 1.8934 μM | SANGER | |||
| RD | Growth inhibition assay | IC50 = 1.89846 μM | SANGER | |||
| ChaGo-K-1 | Growth inhibition assay | IC50 = 1.91033 μM | SANGER | |||
| SNU-C1 | Growth inhibition assay | IC50 = 1.914 μM | SANGER | |||
| NCI-H1436 | Growth inhibition assay | IC50 = 1.92742 μM | SANGER | |||
| HOP-92 | Growth inhibition assay | IC50 = 1.93658 μM | SANGER | |||
| HT55 | Growth inhibition assay | IC50 = 1.95457 μM | SANGER | |||
| K-562 | Growth inhibition assay | IC50 = 1.97869 μM | SANGER | |||
| NCI-H2052 | Growth inhibition assay | IC50 = 1.98812 μM | SANGER | |||
| HT-1197 | Growth inhibition assay | IC50 = 2.02174 μM | SANGER | |||
| SW1463 | Growth inhibition assay | IC50 = 2.08169 μM | SANGER | |||
| COLO-829 | Growth inhibition assay | IC50 = 2.08684 μM | SANGER | |||
| DMS-114 | Growth inhibition assay | IC50 = 2.08692 μM | SANGER | |||
| EFM-19 | Growth inhibition assay | IC50 = 2.08896 μM | SANGER | |||
| LN-405 | Growth inhibition assay | IC50 = 2.15428 μM | SANGER | |||
| UACC-62 | Growth inhibition assay | IC50 = 2.15533 μM | SANGER | |||
| MDA-MB-134-VI | Growth inhibition assay | IC50 = 2.1586 μM | SANGER | |||
| MDA-MB-157 | Growth inhibition assay | IC50 = 2.19254 μM | SANGER | |||
| COLO-741 | Growth inhibition assay | IC50 = 2.19928 μM | SANGER | |||
| JEG-3 | Growth inhibition assay | IC50 = 2.23191 μM | SANGER | |||
| NB6 | Growth inhibition assay | IC50 = 2.23352 μM | SANGER | |||
| NCI-H1395 | Growth inhibition assay | IC50 = 2.23483 μM | SANGER | |||
| KARPAS-45 | Growth inhibition assay | IC50 = 2.27184 μM | SANGER | |||
| HCC1954 | Growth inhibition assay | IC50 = 2.28119 μM | SANGER | |||
| A704 | Growth inhibition assay | IC50 = 2.38311 μM | SANGER | |||
| SK-N-DZ | Growth inhibition assay | IC50 = 2.38958 μM | SANGER | |||
| EGI-1 | Growth inhibition assay | IC50 = 2.39059 μM | SANGER | |||
| TALL-1 | Growth inhibition assay | IC50 = 2.3955 μM | SANGER | |||
| PANC-08-13 | Growth inhibition assay | IC50 = 2.39777 μM | SANGER | |||
| NCI-H28 | Growth inhibition assay | IC50 = 2.43524 μM | SANGER | |||
| DMS-79 | Growth inhibition assay | IC50 = 2.47163 μM | SANGER | |||
| NCI-H889 | Growth inhibition assay | IC50 = 2.48342 μM | SANGER | |||
| Ramos-2G6-4C10 | Growth inhibition assay | IC50 = 2.54572 μM | SANGER | |||
| BT-474 | Growth inhibition assay | IC50 = 2.62326 μM | SANGER | |||
| JVM-3 | Growth inhibition assay | IC50 = 2.64752 μM | SANGER | |||
| NCI-H524 | Growth inhibition assay | IC50 = 2.7032 μM | SANGER | |||
| SK-MM-2 | Growth inhibition assay | IC50 = 2.71695 μM | SANGER | |||
| TGW | Growth inhibition assay | IC50 = 2.75803 μM | SANGER | |||
| Capan-2 | Growth inhibition assay | IC50 = 2.78528 μM | SANGER | |||
| NCI-H82 | Growth inhibition assay | IC50 = 2.80193 μM | SANGER | |||
| NCI-H716 | Growth inhibition assay | IC50 = 2.82042 μM | SANGER | |||
| MSTO-211H | Growth inhibition assay | IC50 = 2.82369 μM | SANGER | |||
| COLO-678 | Growth inhibition assay | IC50 = 2.88691 μM | SANGER | |||
| AsPC-1 | Growth inhibition assay | IC50 = 2.89855 μM | SANGER | |||
| DV-90 | Growth inhibition assay | IC50 = 2.92143 μM | SANGER | |||
| SNU-387 | Growth inhibition assay | IC50 = 2.93467 μM | SANGER | |||
| KLE | Growth inhibition assay | IC50 = 2.98224 μM | SANGER | |||
| U-118-MG | Growth inhibition assay | IC50 = 3.14284 μM | SANGER | |||
| MHH-PREB-1 | Growth inhibition assay | IC50 = 3.14735 μM | SANGER | |||
| MDA-MB-175-VII | Growth inhibition assay | IC50 = 3.15819 μM | SANGER | |||
| EB-3 | Growth inhibition assay | IC50 = 3.19768 μM | SANGER | |||
| HuH-7 | Growth inhibition assay | IC50 = 3.22286 μM | SANGER | |||
| NCI-H1522 | Growth inhibition assay | IC50 = 3.23546 μM | SANGER | |||
| MDA-MB-231 | Growth inhibition assay | IC50 = 3.23964 μM | SANGER | |||
| NCI-H1092 | Growth inhibition assay | IC50 = 3.2799 μM | SANGER | |||
| KU-19-19 | Growth inhibition assay | IC50 = 3.35835 μM | SANGER | |||
| SNU-449 | Growth inhibition assay | IC50 = 3.36209 μM | SANGER | |||
| CAS-1 | Growth inhibition assay | IC50 = 3.38185 μM | SANGER | |||
| KP-N-YN | Growth inhibition assay | IC50 = 3.41535 μM | SANGER | |||
| P31-FUJ | Growth inhibition assay | IC50 = 3.45775 μM | SANGER | |||
| RMG-I | Growth inhibition assay | IC50 = 3.46127 μM | SANGER | |||
| SN12C | Growth inhibition assay | IC50 = 3.46177 μM | SANGER | |||
| HCC1419 | Growth inhibition assay | IC50 = 3.48402 μM | SANGER | |||
| TT | Growth inhibition assay | IC50 = 3.67775 μM | SANGER | |||
| SW948 | Growth inhibition assay | IC50 = 3.75281 μM | SANGER | |||
| SCC-9 | Growth inhibition assay | IC50 = 3.78753 μM | SANGER | |||
| KMS-12-PE | Growth inhibition assay | IC50 = 3.82788 μM | SANGER | |||
| GMS-10 | Growth inhibition assay | IC50 = 3.83807 μM | SANGER | |||
| EW-18 | Growth inhibition assay | IC50 = 3.9388 μM | SANGER | |||
| SK-MEL-2 | Growth inhibition assay | IC50 = 3.97464 μM | SANGER | |||
| PC-3 | Growth inhibition assay | IC50 = 4.07159 μM | SANGER | |||
| IST-MES1 | Growth inhibition assay | IC50 = 4.14621 μM | SANGER | |||
| PLC-PRF-5 | Growth inhibition assay | IC50 = 4.19446 μM | SANGER | |||
| YAPC | Growth inhibition assay | IC50 = 4.36751 μM | SANGER | |||
| RXF393 | Growth inhibition assay | IC50 = 4.38975 μM | SANGER | |||
| LP-1 | Growth inhibition assay | IC50 = 4.55967 μM | SANGER | |||
| JAR | Growth inhibition assay | IC50 = 4.56384 μM | SANGER | |||
| GCT | Growth inhibition assay | IC50 = 4.6047 μM | SANGER | |||
| SW1088 | Growth inhibition assay | IC50 = 4.66827 μM | SANGER | |||
| NCI-H345 | Growth inhibition assay | IC50 = 4.73193 μM | SANGER | |||
| Calu-1 | Growth inhibition assay | IC50 = 4.8072 μM | SANGER | |||
| ECC4 | Growth inhibition assay | IC50 = 5.07036 μM | SANGER | |||
| DOK | Growth inhibition assay | IC50 = 5.1551 μM | SANGER | |||
| RL | Growth inhibition assay | IC50 = 5.43657 μM | SANGER | |||
| NCI-H1755 | Growth inhibition assay | IC50 = 5.43694 μM | SANGER | |||
| HTC-C3 | Growth inhibition assay | IC50 = 5.78944 μM | SANGER | |||
| PFSK-1 | Growth inhibition assay | IC50 = 5.88351 μM | SANGER | |||
| CAL-120 | Growth inhibition assay | IC50 = 5.96351 μM | SANGER | |||
| Hs-578-T | Growth inhibition assay | IC50 = 6.20302 μM | SANGER | |||
| DG-75 | Growth inhibition assay | IC50 = 6.2494 μM | SANGER | |||
| NCI-H2227 | Growth inhibition assay | IC50 = 6.32364 μM | SANGER | |||
| OPM-2 | Growth inhibition assay | IC50 = 6.34857 μM | SANGER | |||
| T47D | Growth inhibition assay | IC50 = 6.37191 μM | SANGER | |||
| HuO-3N1 | Growth inhibition assay | IC50 = 6.45452 μM | SANGER | |||
| D-392MG | Growth inhibition assay | IC50 = 6.68451 μM | SANGER | |||
| NCI-SNU-16 | Growth inhibition assay | IC50 = 6.74309 μM | SANGER | |||
| CW-2 | Growth inhibition assay | IC50 = 7.72758 μM | SANGER | |||
| no-11 | Growth inhibition assay | IC50 = 7.74202 μM | SANGER | |||
| MFE-280 | Growth inhibition assay | IC50 = 8.34873 μM | SANGER | |||
| KINGS-1 | Growth inhibition assay | IC50 = 8.61164 μM | SANGER | |||
| HCC1187 | Growth inhibition assay | IC50 = 8.9213 μM | SANGER | |||
| NCI-H2452 | Growth inhibition assay | IC50 = 8.93628 μM | SANGER | |||
| C2BBe1 | Growth inhibition assay | IC50 = 9.284 μM | SANGER | |||
| Mewo | Growth inhibition assay | IC50 = 9.55233 μM | SANGER | |||
| MFM-223 | Growth inhibition assay | IC50 = 10.3807 μM | SANGER | |||
| NCI-H446 | Growth inhibition assay | IC50 = 12.4227 μM | SANGER | |||
| RO82-W-1 | Growth inhibition assay | IC50 = 13.3274 μM | SANGER | |||
| EC-GI-10 | Growth inhibition assay | IC50 = 14.9132 μM | SANGER | |||
| UACC-812 | Growth inhibition assay | IC50 = 16.8306 μM | SANGER | |||
| SK-MEL-28 | Growth inhibition assay | IC50 = 18.9731 μM | SANGER | |||
| DK-MG | Growth inhibition assay | IC50 = 21.667 μM | SANGER | |||
| NCI-H1993 | Growth inhibition assay | IC50 = 22.984 μM | SANGER | |||
| U-2-OS | Growth inhibition assay | IC50 = 23.6987 μM | SANGER | |||
| MKN7 | Growth inhibition assay | IC50 = 27.8562 μM | SANGER | |||
| SK-N-FI | Growth inhibition assay | IC50 = 39.7075 μM | SANGER | |||
| CAL-72 | Growth inhibition assay | IC50 = 46.7339 μM | SANGER | |||
| Klik om meer experimentele gegevens over de cellijn te bekijken | ||||||
| Moleculair gewicht | 334.37 | Formule | C15H18N4O5 |
Opslag (Vanaf de ontvangstdatum) | 3 years -20°C(in the dark) powder |
|---|---|---|---|---|---|
| CAS-nr. | 50-07-7 | SDF downloaden | Opslag van stamoplossingen |
|
|
| Synoniemen | Ametycine | Smiles | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N | ||
|
In vitro |
DMSO
: 66 mg/mL
(197.38 mM)
Water : Insoluble Ethanol : Insoluble |
|
In vivo |
|||||
Stap 1: Voer de onderstaande informatie in (Aanbevolen: Een extra dier voor het geval van verlies tijdens het experiment)
Stap 2: Voer de in vivo formulering in (Dit is alleen de calculator, geen formulering. Neem eerst contact met ons op als er geen in vivo formulering is in het gedeelte Oplosbaarheid.)
Berekeningsresultaten:
Werkconcentratie: mg/ml;
Methode voor het bereiden van DMSO-mastervloeistof: mg geneesmiddel vooraf opgelost in μL DMSO ( Concentratie mastervloeistof mg/mL, Neem eerst contact met ons op als de concentratie de DMSO-oplosbaarheid van de partij geneesmiddel overschrijdt. )
Methode voor het bereiden van in vivo formulering: Neem μL DMSO mastervloeistof, voeg vervolgens toeμL PEG300, mengen en helder maken, voeg vervolgens toeμL Tween 80, mengen en helder maken, voeg vervolgens toe μL ddH2O, mengen en helder maken.
Methode voor het bereiden van in vivo formulering: Neem μL DMSO mastervloeistof, voeg vervolgens toe μL Maïsolie, mengen en helder maken.
Opmerking: 1. Zorg ervoor dat de vloeistof helder is voordat u het volgende oplosmiddel toevoegt.
2. Zorg ervoor dat u het/de oplosmiddel(en) in de juiste volgorde toevoegt. U moet ervoor zorgen dat de verkregen oplossing, bij de vorige toevoeging, een heldere oplossing is voordat u verdergaat met het toevoegen van het volgende oplosmiddel. Fysische methoden zoals vortexen, echografie of een warmwaterbad kunnen worden gebruikt om het oplossen te bevorderen.
| Targets/IC50/Ki |
DNA synthesis
|
|---|---|
| In vitro |
Mitomycin C, door inductie van DNA-interstreng-dwarsverbindingen, blokkeert fysiek DNA-replicatie, recombinatie en RNA-transcriptie. Deze verbinding potentieert TRAIL-geïnduceerde apoptose in HCT116 (p53-/-) darmkankercellen en sensibiliseert TRAIL-resistente darmkankercellen HT-29 voor de cytokine door JNK-onafhankelijke opregulatie van doodsreceptoren. In verschillende menselijke kankercellijnen, zoals OVCAR-5 (eierstok), HT-29 (darm), SK-N-MC (neuroblastoom), HEP-2 (lever), COLO-205 (darm), NIH-OVCAR-3 (eierstok) en A-549 (long) cellen, vertoont deze chemische stof cytotoxische activiteit. |
| In vivo |
Als de klinische eerste keuze bij oppervlakkige blaastumoren, in een rattenblaastumormodel, voorkomt Mitomycin C (400 μM) significant de intravesicale tumorgroei. |
Referenties |
|
| Methoden | Biomarkers | Afbeeldingen | PMID |
|---|---|---|---|
| Western blot | PARP / Caspase 8 / Caspase 9 / Cleaved caspase-9 / Caspase 3 / Cleaved caspase-3 p-Akt / Akt / p-S6K / S6K / p-Jun / JNK Beclin 1 / p62 / ATG5 GRP78 / CHOP / Caspase-4 / Cleaved caspase-4 |
|
24901052 |
(gegevens van https://clinicaltrials.gov, bijgewerkt op 2024-05-22)
| NCT-nummer | Rekrutering | Aandoeningen | Sponsor/Medewerkers | Startdatum | Fasen |
|---|---|---|---|---|---|
| NCT04934540 | Recruiting | Bladder Cancer |
Chinese University of Hong Kong |
January 1 2020 | -- |
| NCT02199327 | Completed | Conjunctival Intraepithelial Neoplasia|Corneal Intraepithelial Neoplasia |
Coordinación de Investigación en Salud Mexico|Instituto Mexicano del Seguro Social|University of Guadalajara |
May 2014 | Phase 4 |
Tel: +1-832-582-8158 Ext:3
Als u nog andere vragen heeft, kunt u een bericht achterlaten.