nur für Forschungszwecke
Kat.-Nr.S2814
| Verwandte Ziele | Akt mTOR GSK-3 ATM/ATR DNA-PK AMPK PDPK1 PTEN PP2A PDK |
|---|---|
| Weitere PI3K Inhibitoren | GDC-0077 (Inavolisib) SAR405 Quercetin (Sophoretin) LY294002 XL147 analogue Tersolisib (STX-478) Buparlisib (BKM120) 740 Y-P (PDGFR 740Y-P) GO-203 TFA Eganelisib (IPI-549) |
| Zelllinien | Assay-Typ | Konzentration | Inkubationszeit | Formulierung | Aktivitätsbeschreibung | PMID |
|---|---|---|---|---|---|---|
| Detroit562 | Growth Inhibition Assay | 0.1-100 μM | 72 h | IC50=1.10 μM | 25550549 | |
| SNU-1076 | Growth Inhibition Assay | 0.1-100 μM | 72 h | IC50=6.82 μM | 25550549 | |
| SNU-1066 | Growth Inhibition Assay | 0.1-100 μM | 72 h | IC50=1.13 μM | 25550549 | |
| FaDu | Growth Inhibition Assay | 0.1-100 μM | 72 h | IC50=19.66 μM | 25550549 | |
| SNU1041 | Growth Inhibition Assay | 0.1-100 μM | 72 h | IC50=20.65 μM | 25550549 | |
| SCC25 | Growth Inhibition Assay | 0.1-100 μM | 72 h | IC50=49.30 μM | 25550549 | |
| BON-1 | Function Assay | 1/10 μM | 4 h | inhibits PI3K (AKT Ser308) and mTORC1/2 activities | 25026292 | |
| QGP-1 | Function Assay | 1/10 μM | 4 h | inhibits PI3K (AKT Ser308) and mTORC1/2 activities | 25026292 | |
| MG-63 | Growth Inhibition Assay | IC50=6 μM, IC90=24 μM | 24961790 | |||
| HOS | Growth Inhibition Assay | IC50=15 μM, IC90=42 μM | 24961790 | |||
| MOS-J | Growth Inhibition Assay | IC50=10 μM, IC90=36 μM | 24961790 | |||
| POS-1 | Growth Inhibition Assay | IC50=8 μM, IC90=36 μM | 24961790 | |||
| 92.1 | Growth Inhibition Assay | 500-2000 nM | 5 d | inhibits the phosphorylation of AKT (Ser473) up to 1 μM | 24563540 | |
| Mel270 | Growth Inhibition Assay | 500-2000 nM | 5 d | inhibits the phosphorylation of AKT (Ser473) up to 1 μM | 24563540 | |
| Omm1.3 | Growth Inhibition Assay | 500-2000 nM | 5 d | inhibits the phosphorylation of AKT (Ser473) up to 1 μM | 24563540 | |
| Omm1 | Growth Inhibition Assay | 500-2000 nM | 5 d | inhibits the phosphorylation of AKT (Ser473) up to 1 μM | 24563540 | |
| C918 | Growth Inhibition Assay | 500-2000 nM | 5 d | inhibits the phosphorylation of AKT (Ser473) up to 1 μM | 24563540 | |
| Mel290 | Growth Inhibition Assay | 500-2000 nM | 5 d | inhibits the phosphorylation of AKT (Ser473) up to 1 μM | 24563540 | |
| OPM2 | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| OPM1 | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| U266 | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| MM1R | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| MM1S | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| H929 | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| RPMI | Growth Inhibition Assay | 0.5-2.5 μM | 48 h | inhibits cell growth in a dose-dependent manner | 24405121 | |
| SKBR3 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 35% cell growth | 23918797 | |
| MDA453 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 38% cell growth | 23918797 | |
| EFM192A | Growth Inhibition Assay | 33 μM | 5 d | inhibits 27% cell growth | 23918797 | |
| AU565 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 26% cell growth | 23918797 | |
| MDA361 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 44% cell growth | 23918797 | |
| BT474 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 16% cell growth | 23918797 | |
| HCC202 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 20% cell growth | 23918797 | |
| KPL4 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 58% cell growth | 23918797 | |
| NCL-N87 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 31% cell growth | 23918797 | |
| UACC812 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 27% cell growth | 23918797 | |
| HCC2218 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 15% cell growth | 23918797 | |
| HCC1569 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 5% cell growth | 23918797 | |
| OE19 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 23% cell growth | 23918797 | |
| OE33 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 23% cell growth | 23918797 | |
| JIMT1 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 9% cell growth | 23918797 | |
| HCC1954 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 29% cell growth | 23918797 | |
| NUGC4 | Growth Inhibition Assay | 33 μM | 5 d | inhibits 14% cell growth | 23918797 | |
| ZR-75-30 | Growth Inhibition Assay | 33 μM | 5 d | inhibits -15% cell growth | 23918797 | |
| Rat1 | P110alpha inhibition assay | IC50 = 0.074 μM | 26164189 | |||
| Rat1 | PI3Kalpha inhibition assay | IC50 = 0.074 μM | 26206504 | |||
| Rat1 | P110alpha inhibition assay | IC50 = 0.074 μM | 23726034 | |||
| Rat1 | P110delta inhibition assay | IC50 = 1.2 μM | 26164189 | |||
| Rat1 | PI3Kgamma inhibition assay | IC50 = 1.2 μM | 26206504 | |||
| Rat1 | P110delta inhibition assay | IC50 = 1.2 μM | 23726034 | |||
| Rat1 | P110beta inhibition assay | IC50 = 2.2 μM | 26164189 | |||
| Rat1 | PI3Kbeta inhibition assay | IC50 = 2.2 μM | 26206504 | |||
| Rat1 | P110alpha inhibition assay | IC50 = 2.2 μM | 23726034 | |||
| Klicken Sie hier, um weitere experimentelle Daten zu Zelllinien anzuzeigen | ||||||
| Molekulargewicht | 441.47 | Formel | C19H22F3N5O2S |
Lagerung (Ab dem Eingangsdatum) | |
|---|---|---|---|---|---|
| CAS-Nr. | 1217486-61-7 | SDF herunterladen | Lagerung von Stammlösungen |
|
|
| Synonyme | N/A | Smiles | CC1=C(SC(=N1)NC(=O)N2CCCC2C(=O)N)C3=CC(=NC=C3)C(C)(C)C(F)(F)F | ||
|
In vitro |
DMSO
: 88 mg/mL
(199.33 mM)
Water : Insoluble Ethanol : Insoluble |
|
In vivo |
|||||
Schritt 1: Geben Sie die untenstehenden Informationen ein (Empfohlen: Ein zusätzliches Tier zur Berücksichtigung von Verlusten während des Experiments)
Schritt 2: Geben Sie die In-vivo-Formulierung ein (Dies ist nur der Rechner, keine Formulierung. Bitte kontaktieren Sie uns zuerst, wenn es im Abschnitt "Löslichkeit" keine In-vivo-Formulierung gibt.)
Berechnungsergebnisse:
Arbeitskonzentration: mg/ml;
Methode zur Herstellung der DMSO-Stammlösung: mg Wirkstoff vorgelöst in μL DMSO ( Konzentration der Stammlösung mg/mL, Bitte kontaktieren Sie uns zuerst, wenn die Konzentration die DMSO-Löslichkeit der Wirkstoffcharge überschreitet. )
Methode zur Herstellung der In-vivo-Formulierung: Nehmen Sie μL DMSO Stammlösung, dann hinzufügenμL PEG300, mischen und klären, dann hinzufügenμL Tween 80, mischen und klären, dann hinzufügen μL ddH2O, mischen und klären.
Methode zur Herstellung der In-vivo-Formulierung: Nehmen Sie μL DMSO Stammlösung, dann hinzufügen μL Maisöl, mischen und klären.
Hinweis: 1. Bitte stellen Sie sicher, dass die Flüssigkeit klar ist, bevor Sie das nächste Lösungsmittel hinzufügen.
2. Achten Sie darauf, das/die Lösungsmittel der Reihe nach hinzuzufügen. Sie müssen sicherstellen, dass die bei der vorherigen Zugabe erhaltene Lösung eine klare Lösung ist, bevor Sie mit der Zugabe des nächsten Lösungsmittels fortfahren. Physikalische Methoden wie Vortex, Ultraschall oder ein heißes Wasserbad können zur Unterstützung des Lösens verwendet werden.
| Targets/IC50/Ki |
PI3Kα
(Cell-free assay) 5 nM
|
|---|---|
| In vitro |
Alpelisib (BYL719) hemmt die Proliferation von Brustkrebszelllinien, die PIK3CA-Mutationen aufweisen, was mit der Hemmung verschiedener nachgeschalteter Signalwege der PI3K/Akt/mTOR-Weg korreliert. |
| In vivo |
Alpelisib (BYL719) zeigt bei Dosen von über 270 mg/Tag eine statistisch signifikante dosisabhängige Anti-Tumor-Wirksamkeit in PIK3CA-mutierten Xenograft-Modellen bei Nagetieren. Es hat eine geringe Clearance, eine Halbwertszeit von 8,5 Stunden, und seine Exposition nimmt dosisproportional zwischen 30 mg/Tag und 450 mg/Tag zu, wobei es eine geringe interindividuelle Variabilität bei Cmax und AUC beim Menschen aufweist. Bei 270 mg/Tag zeigt diese Verbindung erste Anzeichen klinischer Wirksamkeit, darunter 1 bestätigtes partielles Ansprechen bei einer Patientin mit ER+-Brustkrebs, und signifikante PET-Ansprechen (PMR) und/oder Tumorverkleinerung werden bei 8 von 17 bewerteten Patienten erreicht. |
Literatur |
|
| Methoden | Biomarker | Bilder | PMID |
|---|---|---|---|
| Western blot | PIM1 / PIM2 / PIM3 / p-PRAS40 / p-RPS6 / p-BAD pS6 (Ser235-236) p-HER2 / IGF-1R p100β / p110α / p85 / p-ERBB3(Y1289) p-AKT(S473) / p-AKT(T308) |
|
27604488 |
| Growth inhibition assay | Cell viability |
|
27602501 |
| Immunofluorescence | LC3 |
|
26637440 |
(Daten von https://clinicaltrials.gov, aktualisiert am 2024-05-22)
| NCT-Nummer | Rekrutierung | Erkrankungen | Sponsor/Kooperationspartner | Startdatum | Phasen |
|---|---|---|---|---|---|
| NCT05948943 | Recruiting | Lymphatic Malformations |
Novartis Pharmaceuticals|Novartis |
November 24 2023 | Phase 2|Phase 3 |
| NCT05660083 | Recruiting | HER2-negative Breast Cancer|Metastatic Breast Cancer|Metaplastic Breast Carcinoma|TNBC - Triple-Negative Breast Cancer |
The Methodist Hospital Research Institute|Novartis Pharmaceuticals |
January 12 2023 | Phase 2 |
| NCT05508906 | Recruiting | Metastatic Breast Cancer|Advanced Breast Cancer|HR-positive Breast Cancer|HER2-negative Breast Cancer |
Olema Pharmaceuticals Inc.|Novartis |
August 31 2022 | Phase 1 |
| NCT05230810 | Recruiting | HER2-positive Metastatic Breast Cancer |
Criterium Inc.|Novartis|Seagen Inc. |
August 25 2022 | Phase 1|Phase 2 |
Tel: +1-832-582-8158 Ext:3
Wenn Sie weitere Fragen haben, hinterlassen Sie bitte eine Nachricht.